Drug Information| Drug ID: | NPD9696 |
| Drug Name: | Azathioprine Sodium |
| Molecular Formula: | C9H6N7O2S.Na |
| Canonical SMILES: | Cn1cnc(c1Sc1ncnc2c1nc[n-]2)N(=O)=O.[Na+] |
| Standard InCHI: | InChI=1S/C9H6N7O2S.Na/c1-15-4-14-7(16(17)18)9(15)19-8-5-6(11-2-10-5)12-3-13-8;/h2-4H,1H3;/q-1;+1 |
| Standard InCHIKey: | WISNYKIQFMKSDQ-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9696Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6642 | NPC189314 |
| Remote Similarity | 0.6587 | NPC87981 |
| Remote Similarity | 0.6587 | NPC174114 |
| Remote Similarity | 0.6308 | NPC476564 |
| Remote Similarity | 0.6096 | NPC104011 |
| Remote Similarity | 0.6061 | NPC18335 |
| Remote Similarity | 0.5956 | NPC4837 |
| Remote Similarity | 0.5956 | NPC312187 |
| Remote Similarity | 0.5862 | NPC248007 |
| Remote Similarity | 0.5849 | NPC136349 |
| Remote Similarity | 0.5741 | NPC328479 |
| Remote Similarity | 0.5736 | NPC51000 |
| Remote Similarity | 0.5655 | NPC139776 |
| Remote Similarity | 0.5612 | NPC47936 |