Drug Information| Drug ID: | NPD9629 |
| Drug Name: | Nimorazole |
| Molecular Formula: | C9H14N4O3 |
| Canonical SMILES: | O=N(=O)c1cncn1CCN1CCOCC1 |
| Standard InCHI: | InChI=1S/C9H14N4O3/c14-13(15)9-7-10-8-12(9)2-1-11-3-5-16-6-4-11/h7-8H,1-6H2 |
| Standard InCHIKey: | MDJFHRLTPRPZLY-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9629Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.87 | NPC332382 |
| Remote Similarity | 0.6667 | NPC190949 |
| Remote Similarity | 0.6 | NPC237936 |
| Remote Similarity | 0.575 | NPC273327 |
| Remote Similarity | 0.5748 | NPC63433 |
| Remote Similarity | 0.5705 | NPC207633 |
| Remote Similarity | 0.5639 | NPC109322 |