NPASS drugs

Drug Information

Drug ID:	NPD9503
Drug Name:	Tegafur-uracil
Molecular Formula:	C8H9FN2O3.C4H4N2O2
Canonical SMILES:	Oc1nc(=O)n(cc1F)C1CCCO1.Oc1ccnc(n1)O
Standard InCHI:	InChI=1S/C8H9FN2O3.C4H4N2O2/c9-5-4-11(6-2-1-3-14-6)8(13)10-7(5)12;7-3-1-2-5-4(8)6-3/h4,6H,1-3H2,(H,10,12,13);1-2H,(H2,5,6,7,8)
Standard InCHIKey:	DHMYGZIEILLVNR-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD9503

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	34
0.1-0.2	17316
0.2-0.3	12123
0.3-0.4	1268
0.4-0.5	110
0.5-0.6	18
0.6-0.7	18
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7179	NPC106780
Intermediate Similarity	0.7089	NPC71339
Intermediate Similarity	0.7089	NPC112842
Remote Similarity	0.6914	NPC43246
Remote Similarity	0.6914	NPC89051
Remote Similarity	0.6829	NPC163352
Remote Similarity	0.6829	NPC210456
Remote Similarity	0.6667	NPC171116
Remote Similarity	0.6588	NPC324390
Remote Similarity	0.6512	NPC327344
Remote Similarity	0.6512	NPC320249
Remote Similarity	0.6512	NPC322594
Remote Similarity	0.6364	NPC324516
Remote Similarity	0.6364	NPC318166
Remote Similarity	0.6364	NPC36985
Remote Similarity	0.6364	NPC17892
Remote Similarity	0.6292	NPC317639
Remote Similarity	0.6292	NPC73765
Remote Similarity	0.6292	NPC283698
Remote Similarity	0.6279	NPC315063
Remote Similarity	0.6	NPC329077
Remote Similarity	0.5926	NPC325902
Remote Similarity	0.5657	NPC329277

Drug Structure

NPD9503 OpenBabel08211713352D 25 26 0 0 1 0 0 0 0 0999 V2000 10.0109 -1.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3417 -2.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5109 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -3.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -3.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -1.7024 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 5.8301 -3.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -4.7024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 5.8301 -2.2024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -2.2024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.9641 -3.7024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -0.7024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5327 -0.7079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -2.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0981 -3.2024 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -5.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 2 6 1 0 0 0 0 3 14 1 0 0 0 0 4 5 2 0 0 0 0 4 11 1 0 0 0 0 5 7 1 0 0 0 0 5 9 1 0 0 0 0 6 11 1 0 0 0 0 6 14 1 0 0 0 0 7 10 2 0 0 0 0 7 12 1 0 0 0 0 8 10 1 0 0 0 0 8 11 1 0 0 0 0 8 13 2 0 0 0 0 12 23 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 16 19 1 0 0 0 0 17 20 2 0 0 0 0 17 21 1 0 0 0 0 18 19 2 0 0 0 0 18 20 1 0 0 0 0 18 22 1 0 0 0 0 21 24 1 0 0 0 0 22 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB09327
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number	74578-38-4

Drug Properties

Molecular Weight	200.06
ALogP	-1.5739
MLogP	1.68
XLogP	0.208
HDA	5
HBD	1
Rotatable Bonds	3
TPSA	62.13
RO5 Violation	0