Drug Information| Drug ID: | NPD9385 |
| Drug Name: | |
| Molecular Formula: | C8H11NO4 |
| Canonical SMILES: | OC(=O)[C@H]1[C@H]2[C@@H]1[C@](CC2)(N)C(=O)O |
| Standard InCHI: | InChI=1S/C8H11NO4/c9-8(7(12)13)2-1-3-4(5(3)8)6(10)11/h3-5H,1-2,9H2,(H,10,11)(H,12,13)/t3-,4-,5-,8-/m0/s1 |
| Standard InCHIKey: | VTAARTQTOOYTES-RGDLXGNYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9385Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7308 | NPC188231 |
| Intermediate Similarity | 0.7308 | NPC222327 |
| Remote Similarity | 0.6351 | NPC155512 |
| Remote Similarity | 0.5875 | NPC319279 |
| Remote Similarity | 0.5854 | NPC302188 |
| Remote Similarity | 0.5825 | NPC160066 |
| Remote Similarity | 0.5773 | NPC69374 |
| Remote Similarity | 0.5773 | NPC90476 |
| Remote Similarity | 0.5769 | NPC183845 |
| Remote Similarity | 0.5769 | NPC279661 |
| Remote Similarity | 0.5747 | NPC15864 |
| Remote Similarity | 0.5658 | NPC476469 |
| Remote Similarity | 0.5632 | NPC474221 |
| Remote Similarity | 0.5632 | NPC130459 |
| Remote Similarity | 0.5632 | NPC478180 |