Drug Information| Drug ID: | NPD9224 |
| Drug Name: | |
| Molecular Formula: | C7H15N5O4 |
| Canonical SMILES: | COC(=O)[C@H](CCCNC(=N)NN(=O)=O)N |
| Standard InCHI: | InChI=1S/C7H15N5O4/c1-16-6(13)5(8)3-2-4-10-7(9)11-12(14)15/h5H,2-4,8H2,1H3,(H3,9,10,11)/t5-/m0/s1 |
| Standard InCHIKey: | KCWZGJVSDFYRIX-YFKPBYRVSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9224Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7671 | NPC327985 |
| Intermediate Similarity | 0.7639 | NPC226453 |
| Intermediate Similarity | 0.7639 | NPC103130 |
| Intermediate Similarity | 0.7368 | NPC133183 |
| Intermediate Similarity | 0.7123 | NPC118429 |
| Remote Similarity | 0.6962 | NPC328457 |
| Remote Similarity | 0.6842 | NPC278881 |
| Remote Similarity | 0.6125 | NPC325534 |
| Remote Similarity | 0.6092 | NPC191774 |
| Remote Similarity | 0.5811 | NPC245768 |
| Remote Similarity | 0.5694 | NPC93081 |
| Remote Similarity | 0.5694 | NPC140872 |
| Remote Similarity | 0.5641 | NPC245346 |
| Remote Similarity | 0.5641 | NPC11433 |
| Remote Similarity | 0.5641 | NPC302003 |
| Remote Similarity | 0.5625 | NPC322206 |