Drug Information| Drug ID: | NPD901 |
| Drug Name: | Etoglucid |
| Molecular Formula: | C12H22O6 |
| Canonical SMILES: | O(CCOCC1OC1)CCOCCOCC1OC1 |
| Standard InCHI: | InChI=1S/C12H22O6/c1(13-3-5-15-7-11-9-17-11)2-14-4-6-16-8-12-10-18-12/h11-12H,1-10H2 |
| Standard InCHIKey: | UMILHIMHKXVDGH-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD901Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6765 | NPC281883 |
| Remote Similarity | 0.625 | NPC230452 |
| Remote Similarity | 0.625 | NPC329496 |
| Remote Similarity | 0.6061 | NPC272307 |
| Remote Similarity | 0.5882 | NPC238135 |
| Remote Similarity | 0.5882 | NPC88135 |
| Remote Similarity | 0.5862 | NPC43196 |
| Remote Similarity | 0.5758 | NPC317724 |
| Remote Similarity | 0.5667 | NPC61373 |
| Remote Similarity | 0.5667 | NPC321400 |