Drug Information| Drug ID: | NPD8597 |
| Drug Name: | Succimer |
| Molecular Formula: | C4H6O4S2 |
| Canonical SMILES: | S[C@H]([C@@H](C(=O)O)S)C(=O)O |
| Standard InCHI: | InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/t1-,2+ |
| Standard InCHIKey: | ACTRVOBWPAIOHC-XIXRPRMCSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8597Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Molecular Weight | 181.97 |
| ALogP | 0.2282 |
| MLogP | 1.24 |
| XLogP | -0.342 |
| HDA | 4 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| TPSA | 152.2 |
| RO5 Violation | 0 |