Drug Information| Drug ID: | NPD8554 |
| Drug Name: | Metformin Hydrochloride |
| Molecular Formula: | C4H11N5.ClH |
| Canonical SMILES: | CN(C(=N)NC(=N)N)C.Cl |
| Standard InCHI: | InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H |
| Standard InCHIKey: | OETHQSJEHLVLGH-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8554Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.