NPASS drugs

Drug Information

Drug ID:	NPD765
Drug Name:	GR-95168
Molecular Formula:	C12H15BrN2O4
Canonical SMILES:	Br/C=C/c1cn([C@@H]2C[C@@H]([C@H](C2)O)CO)c(=O)nc1O
Standard InCHI:	InChI=1S/C12H15BrN2O4/c13-2-1-7-5-15(12(19)14-11(7)18)9-3-8(6-16)10(17)4-9/h1-2,5,8-10,16-17H,3-4,6H2,(H,14,18,19)/b2-1+/t8-,9-,10+/m1/s1
Standard InCHIKey:	KAVDAMFOTJIBCK-CTNBOOGPSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD765

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	63
0.1-0.2	546
0.2-0.3	17695
0.3-0.4	11205
0.4-0.5	1282
0.5-0.6	84
0.6-0.7	15
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.68	NPC71339
Remote Similarity	0.68	NPC112842
Remote Similarity	0.6602	NPC163352
Remote Similarity	0.6602	NPC210456
Remote Similarity	0.6535	NPC106780
Remote Similarity	0.6476	NPC171116
Remote Similarity	0.6355	NPC327344
Remote Similarity	0.6346	NPC43246
Remote Similarity	0.6346	NPC89051
Remote Similarity	0.6239	NPC318166
Remote Similarity	0.6239	NPC324516
Remote Similarity	0.6111	NPC324390
Remote Similarity	0.6055	NPC322594
Remote Similarity	0.6055	NPC320249
Remote Similarity	0.6036	NPC317639
Remote Similarity	0.5946	NPC36985
Remote Similarity	0.5946	NPC17892
Remote Similarity	0.5902	NPC478024
Remote Similarity	0.5893	NPC283698
Remote Similarity	0.5893	NPC73765
Remote Similarity	0.5872	NPC315063
Remote Similarity	0.5728	NPC325902
Remote Similarity	0.5727	NPC316186
Remote Similarity	0.5606	NPC315058

Drug Structure

NPD765 OpenBabel08201723412D 22 23 0 0 1 0 0 0 0 0999 V2000 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9706 -1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7796 -0.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3554 -2.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9487 -1.7024 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4487 -0.8364 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 4.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7677 -3.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4432 -0.7319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7731 -3.3205 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0310 -1.5409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 7 1 0 0 0 0 2 13 1 0 0 0 0 3 8 1 0 0 0 0 4 9 1 0 0 0 0 4 10 1 0 0 0 0 5 7 2 0 0 0 0 5 15 1 0 0 0 0 6 16 1 0 0 0 0 7 11 1 0 0 0 0 8 6 1 1 0 0 0 8 10 1 0 0 0 0 9 3 1 1 0 0 0 9 15 1 0 0 0 0 10 17 1 6 0 0 0 11 14 2 0 0 0 0 11 18 1 0 0 0 0 12 14 1 0 0 0 0 12 15 1 0 0 0 0 12 19 2 0 0 0 0 16 20 1 0 0 0 0 17 21 1 0 0 0 0 18 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB007665
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	330.02
ALogP	-1.595
MLogP	2.01
XLogP	0.743
HDA	6
HBD	3
Rotatable Bonds	7
TPSA	93.36
RO5 Violation	0