Drug Information| Drug ID: | NPD7378 |
| Drug Name: | Dimethyl Sulfoxide |
| Molecular Formula: | C2H6OS |
| Canonical SMILES: | CS(=O)C |
| Standard InCHI: | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
| Standard InCHIKey: | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD7378Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC42017 |
| Intermediate Similarity | 0.8462 | NPC256853 |
| Intermediate Similarity | 0.8333 | NPC208362 |
| Remote Similarity | 0.5833 | NPC194465 |
| Remote Similarity | 0.5714 | NPC268218 |
| Remote Similarity | 0.5625 | NPC323500 |