NPASS drugs

Drug Information

Drug ID:	NPD500
Drug Name:	A-79296
Molecular Formula:	C11H13BrN2O5
Canonical SMILES:	Br/C=C/c1cn(c(=O)nc1O)[C@@H]1O[C@@H]([C@H]1CO)CO
Standard InCHI:	InChI=1S/C11H13BrN2O5/c12-2-1-6-3-14(11(18)13-9(6)17)10-7(4-15)8(5-16)19-10/h1-3,7-8,10,15-16H,4-5H2,(H,13,17,18)/b2-1+/t7-,8-,10-/m1/s1
Standard InCHIKey:	INHJOWZUTZSRFC-VWGXYKGWSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD500

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	68
0.1-0.2	1006
0.2-0.3	21761
0.3-0.4	7450
0.4-0.5	551
0.5-0.6	32
0.6-0.7	14
0.7-0.8	8
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7391	NPC112842
Intermediate Similarity	0.7391	NPC71339
Intermediate Similarity	0.734	NPC163352
Intermediate Similarity	0.734	NPC210456
Intermediate Similarity	0.7097	NPC106780
Intermediate Similarity	0.7053	NPC43246
Intermediate Similarity	0.7053	NPC89051
Intermediate Similarity	0.701	NPC171116
Remote Similarity	0.6869	NPC327344
Remote Similarity	0.6733	NPC324516
Remote Similarity	0.6733	NPC318166
Remote Similarity	0.6667	NPC317639
Remote Similarity	0.66	NPC324390
Remote Similarity	0.6569	NPC36985
Remote Similarity	0.6569	NPC17892
Remote Similarity	0.6535	NPC322594
Remote Similarity	0.6535	NPC320249
Remote Similarity	0.6505	NPC283698
Remote Similarity	0.6505	NPC73765
Remote Similarity	0.65	NPC315063
Remote Similarity	0.6211	NPC325902
Remote Similarity	0.6105	NPC329077
Remote Similarity	0.5929	NPC329277
Remote Similarity	0.5922	NPC328806
Remote Similarity	0.5897	NPC478024
Remote Similarity	0.5826	NPC155087
Remote Similarity	0.5826	NPC149843
Remote Similarity	0.5784	NPC325723
Remote Similarity	0.5686	NPC229249
Remote Similarity	0.5673	NPC190334
Remote Similarity	0.5673	NPC62927

Drug Structure

NPD500 OpenBabel08201723202D 22 23 0 0 1 0 0 0 0 0999 V2000 4.3461 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3801 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1213 -3.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4483 -2.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0191 -2.3449 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 2.1554 -3.3801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4483 1.6730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8284 -3.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4824 -2.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1554 2.3801 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5696 -4.7944 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 6 1 0 0 0 0 2 12 1 0 0 0 0 3 6 2 0 0 0 0 3 14 1 0 0 0 0 4 15 1 0 0 0 0 5 16 1 0 0 0 0 6 9 1 0 0 0 0 7 4 1 6 0 0 0 7 8 1 0 0 0 0 7 10 1 0 0 0 0 8 5 1 1 0 0 0 8 19 1 0 0 0 0 9 13 2 0 0 0 0 9 17 1 0 0 0 0 10 14 1 1 0 0 0 10 19 1 0 0 0 0 11 13 1 0 0 0 0 11 14 1 0 0 0 0 11 18 2 0 0 0 0 15 20 1 0 0 0 0 16 21 1 0 0 0 0 17 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB014331
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	332.00
ALogP	-1.5225
MLogP	1.79
XLogP	-0.455
HDA	7
HBD	3
Rotatable Bonds	8
TPSA	102.59
RO5 Violation	0