NPASS drugs

Drug Information

Drug ID:	NPD4482
Drug Name:	Diacetylmorphine
Molecular Formula:	C21H23NO5
Canonical SMILES:	CC(=O)O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1OC(=O)C
Standard InCHI:	InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1
Standard InCHIKey:	GVGLGOZIDCSQPN-PVHGPHFFSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4482

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	262
0.1-0.2	1207
0.2-0.3	2952
0.3-0.4	7359
0.4-0.5	6261
0.5-0.6	7191
0.6-0.7	5457
0.7-0.8	185
0.8-0.85	4
0.85-0.9	2
0.9-0.95	8
0.95-1	2

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC311781
High Similarity	0.9719	NPC174783
High Similarity	0.9402	NPC140577
High Similarity	0.9402	NPC43069
High Similarity	0.9297	NPC67346
High Similarity	0.9194	NPC232533
High Similarity	0.9101	NPC157958
High Similarity	0.9091	NPC243483
High Similarity	0.9091	NPC97086
High Similarity	0.9006	NPC214629

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4482 OpenBabel08211705262D 27 31 0 0 1 0 0 0 0 0999 V2000 1.2322 3.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5133 -2.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1758 -1.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2217 1.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 -1.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4738 2.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4738 -2.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7176 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9697 0.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3733 2.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7341 -1.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 0.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 -0.8636 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9697 -0.4318 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7259 1.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7259 -1.7273 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4738 0.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7259 0.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7259 -0.8637 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4738 -0.4318 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7176 -0.8636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.1343 3.6464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6668 -0.8094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0220 2.1587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0220 -2.1591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 12 1 0 0 0 0 3 22 1 0 0 0 0 4 6 2 0 0 0 0 4 13 1 0 0 0 0 5 7 2 0 0 0 0 5 14 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 22 1 0 0 0 0 10 13 1 0 0 0 0 11 23 2 0 0 0 0 11 25 1 0 0 0 0 12 24 2 0 0 0 0 12 26 1 0 0 0 0 13 18 2 0 0 0 0 14 15 1 0 0 0 0 14 21 1 1 0 0 0 15 10 1 6 0 0 0 15 22 1 0 0 0 0 16 19 2 0 0 0 0 16 25 1 0 0 0 0 17 20 1 0 0 0 0 17 26 1 1 0 0 0 18 19 1 0 0 0 0 18 21 1 0 0 0 0 19 27 1 0 0 0 0 20 21 1 1 0 0 0 20 27 1 0 0 0 0 21 8 1 6 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001673
DrugBank	DB01452
ChEMBL	CHEMBL459324
IUPHAR/BPS
PharmaGKB	PA452619
KEGG Drug	D07286
PubChem CID	5462328
ChEBI	27808
CAS Number	561-27-3

Drug Properties

Molecular Weight	369.16
ALogP	0.1597
MLogP	3.11
XLogP	1.043
HDA	6
HBD	0
Rotatable Bonds	7
TPSA	65.07
RO5 Violation	0