NPASS drugs

Drug Information

Drug ID:	NPD2447
Drug Name:	FR-183998
Molecular Formula:	C17H19Cl2N5O2S
Canonical SMILES:	CN(CCN=C(c1cc(cc(c1)c1cc(sc1Cl)Cl)C(=NC(=N)N)O)O)C
Standard InCHI:	InChI=1S/C17H19Cl2N5O2S/c1-24(2)4-3-22-15(25)10-5-9(12-8-13(18)27-14(12)19)6-11(7-10)16(26)23-17(20)21/h5-8H,3-4H2,1-2H3,(H,22,25)(H4,20,21,23,26)
Standard InCHIKey:	WRLFHDDGGGWFLH-UHFFFAOYSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2447

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	179
0.1-0.2	1252
0.2-0.3	8117
0.3-0.4	11270
0.4-0.5	9462
0.5-0.6	606
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6204	NPC33168
Remote Similarity	0.6015	NPC198747
Remote Similarity	0.6013	NPC324702
Remote Similarity	0.6013	NPC273830
Remote Similarity	0.5955	NPC208280
Remote Similarity	0.5915	NPC318154
Remote Similarity	0.5912	NPC265521
Remote Similarity	0.5903	NPC211551
Remote Similarity	0.5903	NPC474559
Remote Similarity	0.5874	NPC471310
Remote Similarity	0.5871	NPC109151
Remote Similarity	0.587	NPC300455
Remote Similarity	0.5806	NPC86966
Remote Similarity	0.5799	NPC128237
Remote Similarity	0.5799	NPC83790
Remote Similarity	0.5786	NPC3371
Remote Similarity	0.5766	NPC172128
Remote Similarity	0.5766	NPC166487
Remote Similarity	0.5742	NPC112823
Remote Similarity	0.5734	NPC328793
Remote Similarity	0.5714	NPC146703
Remote Similarity	0.5706	NPC311658
Remote Similarity	0.5706	NPC3202
Remote Similarity	0.5694	NPC475115
Remote Similarity	0.5671	NPC132847
Remote Similarity	0.5663	NPC316906
Remote Similarity	0.56	NPC474149

Drug Structure

NPD2447 OpenBabel08211702172D 32 33 0 0 0 0 0 0 0 0999 V2000 1.0154 3.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1494 2.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5827 3.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7167 3.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 1.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3147 0.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1808 1.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4781 -0.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 0.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3147 2.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1808 0.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5827 0.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6691 0.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3147 3.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0468 0.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9128 1.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0933 -1.7796 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -0.4612 1.7213 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -5.0468 2.3364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.7788 2.3364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 3.8364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.9128 0.8364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1494 3.3364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.1808 3.8364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0468 -0.6636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -5.0468 3.3364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7788 3.3364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6449 1.8364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1808 4.8364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9128 -1.1636 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 24 1 0 0 0 0 2 24 1 0 0 0 0 3 4 1 0 0 0 0 3 22 1 0 0 0 0 4 24 1 0 0 0 0 5 9 2 0 0 0 0 5 10 1 0 0 0 0 6 9 1 0 0 0 0 6 11 2 0 0 0 0 7 10 2 0 0 0 0 7 11 1 0 0 0 0 8 12 1 0 0 0 0 8 13 2 0 0 0 0 9 12 1 0 0 0 0 10 15 1 0 0 0 0 11 16 1 0 0 0 0 12 14 2 0 0 0 0 13 18 1 0 0 0 0 13 27 1 0 0 0 0 14 19 1 0 0 0 0 14 27 1 0 0 0 0 15 22 2 3 0 0 0 15 25 1 0 0 0 0 16 23 2 3 0 0 0 16 26 1 0 0 0 0 17 20 2 0 0 0 0 17 21 1 0 0 0 0 17 23 1 0 0 0 0 20 28 1 0 0 0 0 21 29 1 0 0 0 0 21 30 1 0 0 0 0 25 31 1 0 0 0 0 26 32 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB007236
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	427.06
ALogP	0.9072
MLogP	2.23
XLogP	2.297
HDA	7
HBD	4
Rotatable Bonds	14
TPSA	146.53
RO5 Violation	0