NPASS drugs

Drug Information

Drug ID:	NPD244
Drug Name:
Molecular Formula:	C10H13N3O4
Canonical SMILES:	OCC1=C[C@H]([C@@H]([C@@H]1O)O)n1ccc(=N)nc1O
Standard InCHI:	InChI=1S/C10H13N3O4/c11-7-1-2-13(10(17)12-7)6-3-5(4-14)8(15)9(6)16/h1-3,6,8-9,14-16H,4H2,(H2,11,12,17)/t6-,8-,9+/m1/s1
Standard InCHIKey:	DUJGMZAICVPCBJ-VDAHYXPESA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD244

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	69
0.1-0.2	766
0.2-0.3	17070
0.3-0.4	11359
0.4-0.5	1416
0.5-0.6	190
0.6-0.7	18
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7228	NPC62927
Intermediate Similarity	0.7228	NPC190334
Remote Similarity	0.699	NPC328806
Remote Similarity	0.6931	NPC229249
Remote Similarity	0.6759	NPC6166
Remote Similarity	0.6759	NPC280946
Remote Similarity	0.6759	NPC226769
Remote Similarity	0.6697	NPC90240
Remote Similarity	0.6697	NPC120887
Remote Similarity	0.6636	NPC328779
Remote Similarity	0.6518	NPC328914
Remote Similarity	0.64	NPC245534
Remote Similarity	0.6364	NPC329384
Remote Similarity	0.626	NPC313813
Remote Similarity	0.6202	NPC315058
Remote Similarity	0.6168	NPC43246
Remote Similarity	0.6168	NPC89051
Remote Similarity	0.61	NPC314678
Remote Similarity	0.6087	NPC315170
Remote Similarity	0.6061	NPC313962
Remote Similarity	0.5981	NPC228638
Remote Similarity	0.5963	NPC163352
Remote Similarity	0.5963	NPC210456
Remote Similarity	0.5905	NPC314762
Remote Similarity	0.5888	NPC106780
Remote Similarity	0.5856	NPC316186
Remote Similarity	0.5789	NPC17892
Remote Similarity	0.5789	NPC36985
Remote Similarity	0.576	NPC478024
Remote Similarity	0.575	NPC55336
Remote Similarity	0.5739	NPC73765
Remote Similarity	0.5739	NPC283698
Remote Similarity	0.5738	NPC313272
Remote Similarity	0.5738	NPC319537
Remote Similarity	0.5714	NPC315063
Remote Similarity	0.5688	NPC71339
Remote Similarity	0.5688	NPC112842
Remote Similarity	0.5673	NPC217095
Remote Similarity	0.5673	NPC264417
Remote Similarity	0.5656	NPC471259
Remote Similarity	0.5652	NPC318142
Remote Similarity	0.5639	NPC36254
Remote Similarity	0.561	NPC315426
Remote Similarity	0.56	NPC251122

Drug Structure

NPD244 OpenBabel08201723122D 22 23 0 0 1 0 0 0 0 0999 V2000 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9706 -1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3554 -2.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9487 -1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 -0.8364 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7796 -0.0933 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3500 -2.7205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4432 -0.7319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9875 0.8849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7567 -3.6341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0310 -1.5409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9385 1.1939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 7 1 0 0 0 0 2 13 1 0 0 0 0 3 5 2 0 0 0 0 4 5 1 0 0 0 0 4 14 1 0 0 0 0 5 8 1 0 0 0 0 6 3 1 6 0 0 0 6 9 1 0 0 0 0 6 13 1 0 0 0 0 7 11 2 0 0 0 0 7 12 1 0 0 0 0 8 9 1 0 0 0 0 8 15 1 1 0 0 0 9 16 1 1 0 0 0 10 12 2 0 0 0 0 10 13 1 0 0 0 0 10 17 1 0 0 0 0 11 18 1 0 0 0 0 14 19 1 0 0 0 0 15 20 1 0 0 0 0 16 21 1 0 0 0 0 17 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC000499
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	72828
ChEBI
CAS Number

Drug Properties

Molecular Weight	239.09
ALogP	-2.0942
MLogP	1.79
XLogP	-0.335
HDA	7
HBD	5
Rotatable Bonds	6
TPSA	120.37
RO5 Violation	0