NPASS drugs

Drug Information

Drug ID:	NPD2252
Drug Name:	Cilastatin
Molecular Formula:	C16H26N2O5S
Canonical SMILES:	OC(=O)[C@H](CSCCCC/C=C(/C(=O)O)N=C([C@H]1CC1(C)C)O)N
Standard InCHI:	InChI=1S/C16H26N2O5S/c1-16(2)8-10(16)13(19)18-12(15(22)23)6-4-3-5-7-24-9-11(17)14(20)21/h6,10-11H,3-5,7-9,17H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)/b12-6-/t10-,11+/m1/s1
Standard InCHIKey:	DHSUYTOATWAVLW-WFVMDLQDSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD2252

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	40
0.1-0.2	525
0.2-0.3	16762
0.3-0.4	11428
0.4-0.5	1999
0.5-0.6	127
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6392	NPC314854
Remote Similarity	0.6392	NPC313911
Remote Similarity	0.6239	NPC132931
Remote Similarity	0.6122	NPC55732
Remote Similarity	0.6071	NPC72401
Remote Similarity	0.6071	NPC325339
Remote Similarity	0.6068	NPC59249
Remote Similarity	0.6023	NPC321419
Remote Similarity	0.6	NPC320057
Remote Similarity	0.5905	NPC472614
Remote Similarity	0.5833	NPC315897
Remote Similarity	0.5818	NPC189764
Remote Similarity	0.5766	NPC144780
Remote Similarity	0.5763	NPC329305
Remote Similarity	0.5743	NPC157173
Remote Similarity	0.573	NPC327748
Remote Similarity	0.573	NPC321468
Remote Similarity	0.5702	NPC474873
Remote Similarity	0.5688	NPC319473
Remote Similarity	0.5676	NPC50902
Remote Similarity	0.5676	NPC233273
Remote Similarity	0.5676	NPC205546
Remote Similarity	0.5667	NPC327170
Remote Similarity	0.5667	NPC329564
Remote Similarity	0.566	NPC202056
Remote Similarity	0.5656	NPC471645
Remote Similarity	0.5656	NPC50694
Remote Similarity	0.5636	NPC472613
Remote Similarity	0.563	NPC175585
Remote Similarity	0.561	NPC288109

Drug Structure

NPD2252 OpenBabel08211701392D 29 29 0 0 1 0 0 0 0 0999 V2000 -0.2588 -0.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9968 0.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1340 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0622 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9282 -2.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7942 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9282 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7942 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6603 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1340 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1962 -2.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -6.7942 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0622 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5263 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -4.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 16 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 1 0 0 0 0 6 12 2 0 0 0 0 7 24 1 0 0 0 0 8 10 1 0 0 0 0 8 16 1 0 0 0 0 9 24 1 0 0 0 0 10 13 1 6 0 0 0 10 16 1 0 0 0 0 11 9 1 6 0 0 0 11 14 1 0 0 0 0 11 17 1 0 0 0 0 12 15 1 0 0 0 0 12 18 1 0 0 0 0 13 18 2 3 0 0 0 13 19 1 0 0 0 0 14 20 2 0 0 0 0 14 21 1 0 0 0 0 15 22 2 0 0 0 0 15 23 1 0 0 0 0 17 25 1 0 0 0 0 17 26 1 0 0 0 0 19 27 1 0 0 0 0 21 28 1 0 0 0 0 23 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000632
DrugBank	DB01597
ChEMBL	CHEMBL766
IUPHAR/BPS	5166
PharmaGKB	PA448998
KEGG Drug
PubChem CID	6435415
ChEBI	3697
CAS Number	82009-34-5

Drug Properties

Molecular Weight	358.16
ALogP	-0.0631
MLogP	2.34
XLogP	-0.214
HDA	7
HBD	4
Rotatable Bonds	17
TPSA	158.51
RO5 Violation	1