Molecular Weight:   | 262.12 |
Volume:   | 266.942 |
LogP:   | 0.984 |
LogD:   | 1.033 |
LogS:   | -2.564 |
# Rotatable Bonds:   | 0 |
TPSA:   | 63.6 |
# H-Bond Aceptor:   | 4 |
# H-Bond Donor:   | 1 |
# Rings:   | 3 |
# Heavy Atoms:   | 4 |
QED Drug-Likeness Score:   | 0.407 |
Synthetic Accessibility Score:   | 4.728 |
Fsp3:   | 0.6 |
Lipinski Rule-of-5:   | Accepted |
Pfizer Rule:   | Accepted |
GSK Rule:   | Accepted |
BMS Rule:   | 2 |
Golden Triangle Rule:   | Accepted |
Chelating Alert:   | 0 |
PAINS Alert:   | 0 |
Caco-2 Permeability:   | -4.54 |
MDCK Permeability:   | 2.5565359464962967e-05 |
Pgp-inhibitor:   | 0.001 |
Pgp-substrate:   | 0.002 |
Human Intestinal Absorption (HIA):   | 0.078 |
20% Bioavailability (F20%):   | 0.847 |
30% Bioavailability (F30%):   | 0.165 |
Blood-Brain-Barrier Penetration (BBB):   | 0.957 |
Plasma Protein Binding (PPB):   | 63.912391662597656% |
Volume Distribution (VD):   | 0.809 |
Pgp-substrate:   | 39.49250411987305% |
CYP1A2-inhibitor:   | 0.078 |
CYP1A2-substrate:   | 0.222 |
CYP2C19-inhibitor:   | 0.043 |
CYP2C19-substrate:   | 0.712 |
CYP2C9-inhibitor:   | 0.05 |
CYP2C9-substrate:   | 0.146 |
CYP2D6-inhibitor:   | 0.006 |
CYP2D6-substrate:   | 0.097 |
CYP3A4-inhibitor:   | 0.44 |
CYP3A4-substrate:   | 0.305 |
Clearance (CL):   | 7.961 |
Half-life (T1/2):   | 0.863 |
hERG Blockers:   | 0.006 |
Human Hepatotoxicity (H-HT):   | 0.159 |
Drug-inuced Liver Injury (DILI):   | 0.608 |
AMES Toxicity:   | 0.026 |
Rat Oral Acute Toxicity:   | 0.814 |
Maximum Recommended Daily Dose:   | 0.425 |
Skin Sensitization:   | 0.416 |
Carcinogencity:   | 0.8 |
Eye Corrosion:   | 0.301 |
Eye Irritation:   | 0.281 |
Respiratory Toxicity:   | 0.912 |
Natural Product ID:   | NPC275960 |
Common Name*:   | Helenalin |
IUPAC Name:   | (3aR,5R,5aR,8aR,9S,9aS)-9-hydroxy-5,8a-dimethyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione |
Synonyms:   | Helenalin |
Standard InCHIKey:   | ZVLOPMNVFLSSAA-XEPQRQSNSA-N |
Standard InCHI:   | InChI=1S/C15H18O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h4-5,7,9-10,12-13,17H,2,6H2,1,3H3/t7-,9+,10-,12-,13+,15+/m1/s1 |
SMILES:   | C=C1C(=O)O[C@H]2[C@@H]1[C@H](O)[C@]1(C)C(=O)C=C[C@H]1[C@@H](C2)C |
Synthetic Gene Cluster:   | n.a. |
ChEMBL Identifier:   | CHEMBL338474 |
PubChem CID:   |
23205 |
Chemical Classification**:   |
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
---|---|---|---|---|---|---|---|---|
NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[15043416] |
NPO33469 | Asteraceae | Family | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18329753] |
NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19299148] |
NPO20876 | Arnica longifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23501116] |
NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO20876 | Arnica longifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Organism ID | NP ID | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
---|
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
---|---|---|---|---|---|---|---|---|
NPT932 | Cell Line | Colon carcinoma cells | Homo sapiens | MG MID | = | 1.42 | uM | PMID[481266] |
NPT91 | Cell Line | KB | Homo sapiens | pED50 | = | 6.12 | n.a. | PMID[481270] |
NPT91 | Cell Line | KB | Homo sapiens | ED50 | = | 0.2 | ug ml-1 | PMID[481270] |
NPT168 | Cell Line | P388 | Mus musculus | T/C | = | 220.0 | n.a. | PMID[481274] |
NPT15 | Cell Line | Jurkat | Homo sapiens | IC50 | = | 0.03 | ug.mL-1 | PMID[481275] |
NPT91 | Cell Line | KB | Homo sapiens | ED50 | = | 0.76 | umol/L | PMID[481277] |
NPT762 | Cell Line | A-431 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[481278] |
NPT762 | Cell Line | A-431 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[481278] |
NPT1171 | Cell Line | HEp-2 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[481278] |
NPT1171 | Cell Line | HEp-2 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[481278] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[481278] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[481278] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | = | 700.0 | nM | PMID[481278] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[481278] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | IC50 | = | 1600.0 | nM | PMID[481278] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | IC50 | = | 1700.0 | nM | PMID[481278] |
NPT2014 | Cell Line | SW872 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[481278] |
NPT2014 | Cell Line | SW872 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[481278] |
NPT133 | Cell Line | ZR-75-1 | Homo sapiens | IC50 | = | 700.0 | nM | PMID[481278] |
NPT133 | Cell Line | ZR-75-1 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[481278] |
NPT133 | Cell Line | ZR-75-1 | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[481278] |
NPT116 | Cell Line | HL-60 | Homo sapiens | IC50 | = | 320.0 | nM | PMID[481278] |
NPT15 | Cell Line | Jurkat | Homo sapiens | IC50 | = | 460.0 | nM | PMID[481279] |
NPT116 | Cell Line | HL-60 | Homo sapiens | IC50 | = | 700.0 | nM | PMID[481279] |
NPT65 | Cell Line | HepG2 | Homo sapiens | ED50 | = | 0.08 | ug ml-1 | PMID[481281] |
NPT168 | Cell Line | P388 | Mus musculus | T/C | = | 162.0 | % | PMID[481281] |
NPT3728 | Individual Protein | p53-binding protein Mdm-2 | Homo sapiens | EC50 | = | 420.0 | nM | PMID[481283] |
NPT1197 | Individual Protein | Huntingtin | Homo sapiens | Potency | = | 2238.7 | nM | PMID[481283] |
NPT537 | Individual Protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 1000.0 | nM | PMID[481283] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | = | 11220.2 | nM | PMID[481284] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 8912.5 | nM | PMID[481284] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 3548.1 | nM | PMID[481283] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 12589.3 | nM | PMID[481284] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 3162.3 | nM | PMID[481283] |
NPT3 | Individual Protein | Thioredoxin glutathione reductase | Schistosoma mansoni | Potency | = | 25118.9 | nM | PMID[481283] |
NPT53 | Individual Protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 79432.8 | nM | PMID[481283] |
NPT53 | Individual Protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 89125.1 | nM | PMID[481284] |
NPT54 | Individual Protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 4466.8 | nM | PMID[481283] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 3981.1 | nM | PMID[481283] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 39810.7 | nM | PMID[481284] |
NPT4358 | Individual Protein | Type-1 angiotensin II receptor | Homo sapiens | IC50 | = | 18639.0 | nM | PMID[481283] |
NPT538 | Individual Protein | Niemann-Pick C1 protein | Homo sapiens | Potency | = | 794.3 | nM | PMID[481283] |
NPT282 | Individual Protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 31622.8 | nM | PMID[481283] |
NPT501 | Individual Protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 39810.7 | nM | PMID[481284] |
NPT59 | Individual Protein | DNA polymerase beta | Homo sapiens | Potency | = | 100000.0 | nM | PMID[481283] |
NPT61 | Individual Protein | Beta-glucocerebrosidase | Homo sapiens | Potency | n.a. | 1584.9 | nM | PMID[481284] |
NPT152 | Individual Protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 3662.6 | nM | PMID[481283] |
NPT2892 | Individual Protein | X-box-binding protein 1 | Homo sapiens | IC50 | = | 2430.0 | nM | PMID[481283] |
NPT443 | Individual Protein | Histone acetyltransferase GCN5 | Homo sapiens | Potency | n.a. | 25118.9 | nM | PMID[481284] |
NPT4120 | Individual Protein | G-protein coupled receptor 55 | Homo sapiens | IC50 | = | 2642.28 | nM | PMID[481283] |
NPT5 | Individual Protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 11220.2 | nM | PMID[481284] |
NPT2893 | Individual Protein | DNA damage-inducible transcript 3 protein | Mus musculus | IC50 | = | 2610.0 | nM | PMID[481283] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 4107.8 | nM | PMID[481283] |
NPT198 | Individual Protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 39810.7 | nM | PMID[481283] |
NPT198 | Individual Protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 31622.8 | nM | PMID[481284] |
NPT15 | Cell Line | Jurkat | Homo sapiens | IC50 | = | 1020.0 | nM | PMID[481283] |
NPT135 | Individual Protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 79432.8 | nM | PMID[481283] |
NPT1397 | Cell Line | INS1 | Rattus norvegicus | AC50 | = | 2268.0 | nM | PMID[481283] |
NPT65 | Cell Line | HepG2 | Homo sapiens | Potency | n.a. | 11220.2 | nM | PMID[481283] |
NPT5114 | Individual Protein | Beta-galactosidase | Escherichia coli | EC50 | > | 40000.0 | nM | PMID[481283] |
NPT154 | Individual Protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 3981.1 | nM | PMID[481283] |
NPT368 | Cell Line | SN12C | Homo sapiens | GI50 | n.a. | 1355.19 | nM | PMID[481285] |
NPT367 | Cell Line | MDA-N | Homo sapiens | GI50 | n.a. | 2084.49 | nM | PMID[481285] |
NPT370 | Cell Line | NCI-H23 | Homo sapiens | GI50 | n.a. | 1659.59 | nM | PMID[481285] |
NPT369 | Cell Line | ACHN | Homo sapiens | GI50 | n.a. | 1659.59 | nM | PMID[481285] |
NPT371 | Cell Line | UO-31 | Homo sapiens | GI50 | n.a. | 1678.8 | nM | PMID[481285] |
NPT116 | Cell Line | HL-60 | Homo sapiens | GI50 | n.a. | 524.81 | nM | PMID[481285] |
NPT374 | Cell Line | SF-539 | Homo sapiens | GI50 | n.a. | 1986.09 | nM | PMID[481285] |
NPT90 | Cell Line | DU-145 | Homo sapiens | GI50 | n.a. | 3793.15 | nM | PMID[481285] |
NPT373 | Cell Line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 1303.17 | nM | PMID[481285] |
NPT375 | Cell Line | Malme-3M | Homo sapiens | GI50 | n.a. | 1686.55 | nM | PMID[481285] |
NPT376 | Cell Line | A498 | Homo sapiens | GI50 | n.a. | 1857.8 | nM | PMID[481285] |
NPT111 | Cell Line | K562 | Homo sapiens | GI50 | n.a. | 622.3 | nM | PMID[481285] |
NPT112 | Cell Line | MOLT-4 | Homo sapiens | GI50 | n.a. | 851.14 | nM | PMID[481285] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 1524.05 | nM | PMID[481285] |
NPT379 | Cell Line | HOP-62 | Homo sapiens | GI50 | n.a. | 5888.44 | nM | PMID[481285] |
NPT380 | Cell Line | U-251 | Homo sapiens | GI50 | n.a. | 769.13 | nM | PMID[481285] |
NPT381 | Cell Line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 1482.52 | nM | PMID[481285] |
NPT382 | Cell Line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 1713.96 | nM | PMID[481285] |
NPT383 | Cell Line | SNB-19 | Homo sapiens | GI50 | n.a. | 2582.26 | nM | PMID[481285] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 3953.67 | nM | PMID[481285] |
NPT572 | Cell Line | DMS-273 | Homo sapiens | GI50 | n.a. | 1531.09 | nM | PMID[481285] |
NPT384 | Cell Line | TK-10 | Homo sapiens | GI50 | n.a. | 4045.76 | nM | PMID[481285] |
NPT385 | Cell Line | SR | Homo sapiens | GI50 | n.a. | 594.29 | nM | PMID[481285] |
NPT573 | Cell Line | M19-MEL | Homo sapiens | GI50 | n.a. | 2818.38 | nM | PMID[481285] |
NPT323 | Cell Line | SW-620 | Homo sapiens | GI50 | n.a. | 719.45 | nM | PMID[481285] |
NPT455 | Cell Line | NCI-H522 | Homo sapiens | GI50 | n.a. | 241.55 | nM | PMID[481285] |
NPT386 | Cell Line | KM12 | Homo sapiens | GI50 | n.a. | 1534.62 | nM | PMID[481285] |
NPT387 | Cell Line | M14 | Homo sapiens | GI50 | n.a. | 1976.97 | nM | PMID[481285] |
NPT388 | Cell Line | NCI-H322M | Homo sapiens | GI50 | n.a. | 2333.46 | nM | PMID[481285] |
NPT389 | Cell Line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 532.11 | nM | PMID[481285] |
NPT456 | Cell Line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 2766.94 | nM | PMID[481285] |
NPT390 | Cell Line | LOX IMVI | Homo sapiens | GI50 | n.a. | 574.12 | nM | PMID[481285] |
NPT457 | Cell Line | BT-549 | Homo sapiens | GI50 | n.a. | 1039.92 | nM | PMID[481285] |
NPT147 | Cell Line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 1862.09 | nM | PMID[481285] |
NPT81 | Cell Line | A549 | Homo sapiens | GI50 | n.a. | 2904.02 | nM | PMID[481285] |
NPT575 | Cell Line | KM-20L2 | Homo sapiens | GI50 | n.a. | 1729.82 | nM | PMID[481285] |
NPT391 | Cell Line | HCC 2998 | Homo sapiens | GI50 | n.a. | 1513.56 | nM | PMID[481285] |
NPT392 | Cell Line | SNB-75 | Homo sapiens | GI50 | n.a. | 35.16 | nM | PMID[481285] |
NPT393 | Cell Line | HCT-116 | Homo sapiens | GI50 | n.a. | 510.5 | nM | PMID[481285] |
NPT148 | Cell Line | HCT-15 | Homo sapiens | GI50 | n.a. | 2333.46 | nM | PMID[481285] |
NPT395 | Cell Line | SF-268 | Homo sapiens | GI50 | n.a. | 3499.45 | nM | PMID[481285] |
NPT394 | Cell Line | EKVX | Homo sapiens | GI50 | n.a. | 3133.29 | nM | PMID[481285] |
NPT83 | Cell Line | MCF7 | Homo sapiens | GI50 | n.a. | 779.83 | nM | PMID[481285] |
NPT731 | Cell Line | LXFL 529 | Homo sapiens | GI50 | n.a. | 493.17 | nM | PMID[481285] |
NPT576 | Cell Line | DMS-114 | Homo sapiens | GI50 | n.a. | 1452.11 | nM | PMID[481285] |
NPT306 | Cell Line | PC-3 | Homo sapiens | GI50 | n.a. | 1918.67 | nM | PMID[481285] |
NPT397 | Cell Line | NCI-H460 | Homo sapiens | GI50 | n.a. | 1725.84 | nM | PMID[481285] |
NPT396 | Cell Line | T47D | Homo sapiens | GI50 | n.a. | 2951.21 | nM | PMID[481285] |
NPT398 | Cell Line | UACC-62 | Homo sapiens | GI50 | n.a. | 1389.95 | nM | PMID[481285] |
NPT400 | Cell Line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 1577.61 | nM | PMID[481285] |
NPT308 | Cell Line | CAKI-1 | Homo sapiens | GI50 | n.a. | 376.7 | nM | PMID[481285] |
NPT458 | Cell Line | IGROV-1 | Homo sapiens | GI50 | n.a. | 2202.93 | nM | PMID[481285] |
NPT399 | Cell Line | SF-295 | Homo sapiens | GI50 | n.a. | 2773.32 | nM | PMID[481285] |
NPT401 | Cell Line | 786-0 | Homo sapiens | GI50 | n.a. | 1253.14 | nM | PMID[481285] |
NPT403 | Cell Line | UACC-257 | Homo sapiens | GI50 | n.a. | 1588.55 | nM | PMID[481285] |
NPT579 | Cell Line | DLD-1 | Homo sapiens | GI50 | n.a. | 557.19 | nM | PMID[481285] |
NPT404 | Cell Line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 313.33 | nM | PMID[481285] |
NPT405 | Cell Line | NCI-H226 | Homo sapiens | GI50 | n.a. | 1629.3 | nM | PMID[481285] |
NPT139 | Cell Line | HT-29 | Homo sapiens | GI50 | n.a. | 1713.96 | nM | PMID[481285] |
NPT170 | Cell Line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 1761.98 | nM | PMID[481285] |
NPT407 | Cell Line | COLO 205 | Homo sapiens | GI50 | n.a. | 1559.55 | nM | PMID[481285] |
NPT406 | Cell Line | RXF 393 | Homo sapiens | GI50 | n.a. | 465.59 | nM | PMID[481285] |
NPT732 | Cell Line | HOP-18 | Homo sapiens | GI50 | n.a. | 2018.37 | nM | PMID[481285] |
NPT111 | Cell Line | K562 | Homo sapiens | IC50 | = | 280.0 | nM | PMID[481286] |
NPT148 | Cell Line | HCT-15 | Homo sapiens | IC50 | = | 290.0 | nM | PMID[481286] |
NPT311 | Cell Line | SK-LU-1 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[481286] |
NPT10 | Individual Protein | Geminin | Homo sapiens | Potency | n.a. | 920.0 | nM | PMID[481283] |
NPT1797 | Individual Protein | Alpha trans-inducing protein (VP16) | Herpes simplex virus (type 1 / strain 17) | IC50 | n.a. | 4374.0 | nM | PMID[481283] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 4.5 | nM | PMID[481284] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 5.6 | nM | PMID[481284] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 19.9 | nM | PMID[481284] |
NPT477 | Individual Protein | DNA dC->dU-editing enzyme APOBEC-3G | Homo sapiens | Potency | n.a. | 562.3 | nM | PMID[481283] |
NPT1798 | Individual Protein | Photoreceptor-specific nuclear receptor | Homo sapiens | IC50 | n.a. | 1921.0 | nM | PMID[481283] |
NPT10 | Individual Protein | Geminin | Homo sapiens | Potency | n.a. | 145.8 | nM | PMID[481283] |
NPT478 | Individual Protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 19952.6 | nM | PMID[481283] |
NPT101 | Individual Protein | Glucagon-like peptide 1 receptor | Homo sapiens | Potency | n.a. | 2511.9 | nM | PMID[481283] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 17729.9 | nM | PMID[481284] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 7308.0 | nM | PMID[481284] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 35375.8 | nM | PMID[481284] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 2810.0 | nM | PMID[481284] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 819.9 | nM | PMID[481283] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 35481.3 | nM | PMID[481284] |
NPT444 | Individual Protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 8912.5 | nM | PMID[481283] |
NPT535 | Individual Protein | Parathyroid hormone receptor | Homo sapiens | Potency | n.a. | 7943.3 | nM | PMID[481283] |
NPT168 | Cell Line | P388 | Mus musculus | Survival | = | 13.4 | day | PMID[481288] |
NPT168 | Cell Line | P388 | Mus musculus | T/C | = | 127.0 | % | PMID[481289] |
NPT1842 | Cell Line | W256 | Rattus norvegicus | T/C | = | 316.0 | % | PMID[481289] |
NPT168 | Cell Line | P388 | Mus musculus | T/C | = | 127.0 | % | PMID[481290] |
NPT1842 | Cell Line | W256 | Rattus norvegicus | T/C | = | 316.0 | % | PMID[481290] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | TGI | = | 100.0 | % | PMID[481291] |
NPT1842 | Cell Line | W256 | Rattus norvegicus | T/C | = | 316.0 | % | PMID[481291] |
NPT168 | Cell Line | P388 | Mus musculus | T/C | = | 127.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 66.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 83.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 12.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 52.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 25.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 30.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 63.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 292.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 70.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 35.0 | % | PMID[481291] |
NPT1490 | Cell Line | Ehrlich | Mus musculus | Activity | = | 183.0 | % | PMID[481291] |
NPT144 | Individual Protein | Telomerase reverse transcriptase | Homo sapiens | IC50 | = | 4000.0 | nM | PMID[481292] |
NPT165 | Cell Line | HeLa | Homo sapiens | EC50 | = | 700.0 | nM | PMID[481293] |
NPT32 | Organism | Mus musculus | Mus musculus | Average survival (days) | = | 3.0 | n.a. | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | Average survival (days) | = | 12.3 | n.a. | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | Average survival (days) | = | 11.9 | n.a. | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | Average survival (days) | = | 15.7 | n.a. | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | Average survival (days) | = | 12.9 | n.a. | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 31.0 | % | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 127.0 | % | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 123.0 | % | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 162.0 | % | PMID[481265] |
NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 134.0 | % | PMID[481265] |
NPT23243 | CELL-LINE | Tumor cancer cell line | Homo sapiens | MG MID | = | 1.45 | uM | PMID[481266] |
NPT23244 | CELL-LINE | Melanoma tumor cell line | n.a. | MG MID | = | 0.62 | uM | PMID[481266] |
NPT2 | Others | Unspecified | SI | = | 2.3 | n.a. | PMID[481266] | |
NPT2 | Others | Unspecified | SI | = | 1.0 | n.a. | PMID[481266] | |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Cytoprotective effect | = | 0.33 | n.a. | PMID[481267] |
NPT983 | Protein Complex | Nuclear factor NF-kappa-B complex | Homo sapiens | IC100 | = | 10.0 | uM | PMID[481268] |
NPT721 | Individual Protein | Nuclear factor NF-kappa-B p65 subunit | Homo sapiens | IC100 | = | 10.0 | uM | PMID[481269] |
NPT20967 | CELL-LINE | Platelet | n.a. | IC50 | = | 4280.0 | nM | PMID[481271] |
NPT2 | Others | Unspecified | IC50 | = | 2500.0 | nM | PMID[481273] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 2400.0 | nM | PMID[481276] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 390.0 | nM | PMID[481276] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 1300.0 | nM | PMID[481278] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 900.0 | nM | PMID[481278] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 500.0 | nM | PMID[481278] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 1200.0 | nM | PMID[481278] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 700.0 | nM | PMID[481278] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 270.0 | nM | PMID[481278] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 230.0 | nM | PMID[481280] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | T/C | = | 316.0 | % | PMID[481281] |
NPT207 | Protein Family | MAP kinase p38 | Homo sapiens | Inhibition | = | 25.0 | % | PMID[481282] |
NPT25088 | PROTEIN FAMILY | Janus Kinase (JAK) | Homo sapiens | Inhibition | = | 25.0 | % | PMID[481282] |
NPT2 | Others | Unspecified | EC50 | = | 4625.0 | nM | PMID[481283] | |
NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Potency | = | 8912.5 | nM | PMID[481283] |
NPT536 | Uncleic Acid | microRNA 21 | Homo sapiens | Potency | = | 1309.2 | nM | PMID[481283] |
NPT93 | Individual Protein | Survival motor neuron protein | Homo sapiens | Potency | = | 5.6 | nM | PMID[481284] |
NPT94 | Individual Protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 25118.9 | nM | PMID[481284] |
NPT2 | Others | Unspecified | Potency | = | 5804.8 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | IC50 | = | 3843.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | EC50 | = | 8316.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 9200.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 891.3 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | IC50 | > | 80000.0 | nM | PMID[481283] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 1041.8 | nM | PMID[481283] |
NPT7 | Individual Protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 56234.1 | nM | PMID[481283] |
NPT8 | Individual Protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 14125.4 | nM | PMID[481283] |
NPT9 | Individual Protein | DNA polymerase eta | Homo sapiens | Potency | n.a. | 89125.1 | nM | PMID[481283] |
NPT698 | Individual Protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 21192.3 | nM | PMID[481284] |
NPT698 | Individual Protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 50118.7 | nM | PMID[481283] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 827.5 | nM | PMID[481283] |
NPT2 | Others | Unspecified | Potency | n.a. | 1584.9 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 1995.3 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | AC50 | = | 4350.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | EC50 | = | 7880.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | AC50 | = | 825.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | AC50 | = | 1530.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 1778.3 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 1412.5 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 580.5 | nM | PMID[481283] | |
NPT861 | Individual Protein | Isocitrate dehydrogenase [NADP] cytoplasmic | Homo sapiens | Potency | n.a. | 1458.1 | nM | PMID[481283] |
NPT840 | Individual Protein | Transcriptional activator Myb | Gallus gallus | IC50 | = | 2371.37 | nM | PMID[481287] |
NPT27 | Others | Unspecified | IC50 | = | 21110.0 | nM | PMID[481287] | |
NPT840 | Individual Protein | Transcriptional activator Myb | Gallus gallus | IC50 | = | 2370.0 | nM | PMID[481287] |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | AC50 | = | 989.0 | nM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 11220.2 | nM | PMID[481284] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | AbsAC35_uM | = | 2.99 | uM | PMID[481283] |
NPT2 | Others | Unspecified | AbsAC35_uM | = | 5.32 | uM | PMID[481283] | |
NPT2 | Others | Unspecified | Potency | n.a. | 14125.4 | nM | PMID[481284] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.083 | ug ml-1 | PMID[481288] |
NPT32 | Organism | Mus musculus | Mus musculus | MNTD | = | 16.8 | mg kg-1 | PMID[481289] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MNTD | = | 2.5 | mg kg-1 | PMID[481289] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.08 | ug ml-1 | PMID[481289] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.08 | ug ml-1 | PMID[481290] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.1 | ug ml-1 | PMID[481291] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.083 | ug ml-1 | PMID[481292] |
NPT2 | Others | Unspecified | Potency | n.a. | 8912.5 | nM | PMID[481283] | |
NPT19 | Organism | Escherichia coli | Escherichia coli | Inhibition | = | 4.79 | % | PMID[481294] |
NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | = | 6.82 | % | PMID[481294] |
NPT85 | Organism | Filobasidiella neoformans | Cryptococcus neoformans | Inhibition | = | -2.82 | % | PMID[481294] |
NPT2922 | Organism | Staphylococcus aureus subsp. aureus | Staphylococcus aureus subsp. aureus | Inhibition | = | 9.39 | % | PMID[481294] |
NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | = | -4.22 | % | PMID[481294] |
NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | = | 9.92 | % | PMID[481294] |
NPT20 | Organism | Candida albicans | Candida albicans | Inhibition | = | 2.42 | % | PMID[481294] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC275960 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Natural Product ID |
---|---|---|
1.0 | High Similarity | NPC48803 |
1.0 | High Similarity | NPC193645 |
1.0 | High Similarity | NPC90121 |
0.9778 | High Similarity | NPC169205 |
0.967 | High Similarity | NPC141191 |
0.9667 | High Similarity | NPC185553 |
0.9438 | High Similarity | NPC70595 |
0.9438 | High Similarity | NPC123177 |
0.9438 | High Similarity | NPC74103 |
0.9438 | High Similarity | NPC150978 |
0.9432 | High Similarity | NPC117405 |
0.9432 | High Similarity | NPC52198 |
0.9326 | High Similarity | NPC253144 |
0.9231 | High Similarity | NPC167219 |
0.9222 | High Similarity | NPC284185 |
0.9167 | High Similarity | NPC203659 |
0.9158 | High Similarity | NPC225353 |
0.9062 | High Similarity | NPC110989 |
0.9011 | High Similarity | NPC111114 |
0.9011 | High Similarity | NPC300312 |
0.9011 | High Similarity | NPC261607 |
0.9 | High Similarity | NPC168679 |
0.9 | High Similarity | NPC12872 |
0.8977 | High Similarity | NPC161957 |
0.8977 | High Similarity | NPC33570 |
0.8977 | High Similarity | NPC21471 |
0.8876 | High Similarity | NPC104961 |
0.8876 | High Similarity | NPC70422 |
0.8876 | High Similarity | NPC70555 |
0.8842 | High Similarity | NPC54843 |
0.8817 | High Similarity | NPC289004 |
0.875 | High Similarity | NPC39588 |
0.8696 | High Similarity | NPC129419 |
0.866 | High Similarity | NPC171759 |
0.8587 | High Similarity | NPC268298 |
0.8571 | High Similarity | NPC474747 |
0.8539 | High Similarity | NPC215294 |
0.8526 | High Similarity | NPC304886 |
0.8511 | High Similarity | NPC135776 |
0.8485 | Intermediate Similarity | NPC475871 |
0.8485 | Intermediate Similarity | NPC475945 |
0.8469 | Intermediate Similarity | NPC477950 |
0.8462 | Intermediate Similarity | NPC236692 |
0.8462 | Intermediate Similarity | NPC238593 |
0.8462 | Intermediate Similarity | NPC309757 |
0.8444 | Intermediate Similarity | NPC165287 |
0.8438 | Intermediate Similarity | NPC142529 |
0.8438 | Intermediate Similarity | NPC91771 |
0.8409 | Intermediate Similarity | NPC223904 |
0.8404 | Intermediate Similarity | NPC131209 |
0.837 | Intermediate Similarity | NPC201658 |
0.837 | Intermediate Similarity | NPC237540 |
0.8352 | Intermediate Similarity | NPC165162 |
0.8351 | Intermediate Similarity | NPC108475 |
0.8351 | Intermediate Similarity | NPC213947 |
0.8351 | Intermediate Similarity | NPC170143 |
0.8316 | Intermediate Similarity | NPC200237 |
0.8316 | Intermediate Similarity | NPC153590 |
0.8298 | Intermediate Similarity | NPC71533 |
0.8298 | Intermediate Similarity | NPC106510 |
0.8283 | Intermediate Similarity | NPC474742 |
0.8261 | Intermediate Similarity | NPC107787 |
0.8247 | Intermediate Similarity | NPC126156 |
0.8242 | Intermediate Similarity | NPC115786 |
0.8229 | Intermediate Similarity | NPC473331 |
0.8229 | Intermediate Similarity | NPC477131 |
0.8222 | Intermediate Similarity | NPC89555 |
0.8218 | Intermediate Similarity | NPC309190 |
0.8218 | Intermediate Similarity | NPC100487 |
0.8218 | Intermediate Similarity | NPC474741 |
0.8211 | Intermediate Similarity | NPC133698 |
0.8202 | Intermediate Similarity | NPC74673 |
0.8202 | Intermediate Similarity | NPC69271 |
0.8191 | Intermediate Similarity | NPC32922 |
0.8152 | Intermediate Similarity | NPC78089 |
0.8132 | Intermediate Similarity | NPC54468 |
0.8125 | Intermediate Similarity | NPC473273 |
0.8125 | Intermediate Similarity | NPC60386 |
0.8125 | Intermediate Similarity | NPC308656 |
0.8125 | Intermediate Similarity | NPC475302 |
0.8125 | Intermediate Similarity | NPC473234 |
0.8125 | Intermediate Similarity | NPC473263 |
0.8119 | Intermediate Similarity | NPC475873 |
0.8113 | Intermediate Similarity | NPC209058 |
0.8111 | Intermediate Similarity | NPC10276 |
0.8111 | Intermediate Similarity | NPC35089 |
0.8105 | Intermediate Similarity | NPC62815 |
0.8105 | Intermediate Similarity | NPC469368 |
0.81 | Intermediate Similarity | NPC110443 |
0.81 | Intermediate Similarity | NPC133907 |
0.81 | Intermediate Similarity | NPC46998 |
0.81 | Intermediate Similarity | NPC128733 |
0.81 | Intermediate Similarity | NPC185141 |
0.81 | Intermediate Similarity | NPC472753 |
0.809 | Intermediate Similarity | NPC470244 |
0.809 | Intermediate Similarity | NPC470239 |
0.8085 | Intermediate Similarity | NPC476805 |
0.8065 | Intermediate Similarity | NPC305475 |
0.8065 | Intermediate Similarity | NPC475461 |
0.8065 | Intermediate Similarity | NPC150755 |
0.8061 | Intermediate Similarity | NPC18019 |
0.8061 | Intermediate Similarity | NPC24956 |
0.8043 | Intermediate Similarity | NPC141193 |
0.8043 | Intermediate Similarity | NPC96259 |
0.8043 | Intermediate Similarity | NPC191476 |
0.8043 | Intermediate Similarity | NPC114979 |
0.8041 | Intermediate Similarity | NPC198853 |
0.8041 | Intermediate Similarity | NPC469632 |
0.8041 | Intermediate Similarity | NPC470013 |
0.8041 | Intermediate Similarity | NPC323008 |
0.8041 | Intermediate Similarity | NPC470010 |
0.8041 | Intermediate Similarity | NPC262133 |
0.8021 | Intermediate Similarity | NPC286341 |
0.8021 | Intermediate Similarity | NPC191339 |
0.802 | Intermediate Similarity | NPC472754 |
0.8 | Intermediate Similarity | NPC295312 |
0.8 | Intermediate Similarity | NPC51507 |
0.8 | Intermediate Similarity | NPC302426 |
0.8 | Intermediate Similarity | NPC73052 |
0.8 | Intermediate Similarity | NPC276356 |
0.8 | Intermediate Similarity | NPC293418 |
0.8 | Intermediate Similarity | NPC155935 |
0.8 | Intermediate Similarity | NPC290508 |
0.8 | Intermediate Similarity | NPC6823 |
0.7981 | Intermediate Similarity | NPC475960 |
0.798 | Intermediate Similarity | NPC311904 |
0.798 | Intermediate Similarity | NPC474343 |
0.798 | Intermediate Similarity | NPC477949 |
0.7979 | Intermediate Similarity | NPC72513 |
0.7979 | Intermediate Similarity | NPC118601 |
0.7961 | Intermediate Similarity | NPC243998 |
0.7957 | Intermediate Similarity | NPC125290 |
0.7957 | Intermediate Similarity | NPC470755 |
0.7957 | Intermediate Similarity | NPC255307 |
0.7941 | Intermediate Similarity | NPC472755 |
0.7938 | Intermediate Similarity | NPC469645 |
0.7938 | Intermediate Similarity | NPC469692 |
0.7921 | Intermediate Similarity | NPC47880 |
0.7921 | Intermediate Similarity | NPC244456 |
0.7921 | Intermediate Similarity | NPC469657 |
0.7917 | Intermediate Similarity | NPC54065 |
0.7917 | Intermediate Similarity | NPC297474 |
0.7917 | Intermediate Similarity | NPC77337 |
0.7917 | Intermediate Similarity | NPC19087 |
0.7917 | Intermediate Similarity | NPC35809 |
0.7917 | Intermediate Similarity | NPC145666 |
0.7912 | Intermediate Similarity | NPC255580 |
0.7912 | Intermediate Similarity | NPC39411 |
0.7912 | Intermediate Similarity | NPC470241 |
0.7912 | Intermediate Similarity | NPC25684 |
0.7912 | Intermediate Similarity | NPC281949 |
0.7912 | Intermediate Similarity | NPC301477 |
0.7905 | Intermediate Similarity | NPC47951 |
0.7895 | Intermediate Similarity | NPC178875 |
0.7895 | Intermediate Similarity | NPC91248 |
0.7895 | Intermediate Similarity | NPC476803 |
0.7895 | Intermediate Similarity | NPC202672 |
0.7879 | Intermediate Similarity | NPC476009 |
0.7872 | Intermediate Similarity | NPC470242 |
0.7872 | Intermediate Similarity | NPC261721 |
0.7864 | Intermediate Similarity | NPC472756 |
0.7857 | Intermediate Similarity | NPC121825 |
0.7857 | Intermediate Similarity | NPC53685 |
0.785 | Intermediate Similarity | NPC123855 |
0.785 | Intermediate Similarity | NPC138757 |
0.785 | Intermediate Similarity | NPC76550 |
0.7849 | Intermediate Similarity | NPC156485 |
0.7849 | Intermediate Similarity | NPC158756 |
0.7849 | Intermediate Similarity | NPC476804 |
0.7843 | Intermediate Similarity | NPC149371 |
0.7843 | Intermediate Similarity | NPC86077 |
0.7835 | Intermediate Similarity | NPC12172 |
0.7835 | Intermediate Similarity | NPC171360 |
0.7835 | Intermediate Similarity | NPC475925 |
0.7835 | Intermediate Similarity | NPC63193 |
0.7835 | Intermediate Similarity | NPC133888 |
0.7835 | Intermediate Similarity | NPC184063 |
0.7835 | Intermediate Similarity | NPC208886 |
0.7835 | Intermediate Similarity | NPC35959 |
0.7835 | Intermediate Similarity | NPC184463 |
0.7835 | Intermediate Similarity | NPC29821 |
0.7835 | Intermediate Similarity | NPC219874 |
0.7835 | Intermediate Similarity | NPC57304 |
0.7835 | Intermediate Similarity | NPC293001 |
0.783 | Intermediate Similarity | NPC471884 |
0.783 | Intermediate Similarity | NPC477103 |
0.783 | Intermediate Similarity | NPC257240 |
0.7826 | Intermediate Similarity | NPC229825 |
0.7822 | Intermediate Similarity | NPC469872 |
0.7822 | Intermediate Similarity | NPC288876 |
0.7822 | Intermediate Similarity | NPC469864 |
0.7812 | Intermediate Similarity | NPC212664 |
0.7812 | Intermediate Similarity | NPC38392 |
0.78 | Intermediate Similarity | NPC91695 |
0.78 | Intermediate Similarity | NPC70145 |
0.7789 | Intermediate Similarity | NPC190753 |
0.7788 | Intermediate Similarity | NPC223450 |
0.7778 | Intermediate Similarity | NPC52044 |
0.7778 | Intermediate Similarity | NPC209355 |
0.7778 | Intermediate Similarity | NPC475900 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC275960 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
---|---|---|---|
1.0 | High Similarity | NPD1698 | Clinical (unspecified phase) |
0.7917 | Intermediate Similarity | NPD5785 | Approved |
0.783 | Intermediate Similarity | NPD6371 | Approved |
0.7714 | Intermediate Similarity | NPD7899 | Clinical (unspecified phase) |
0.7677 | Intermediate Similarity | NPD5282 | Discontinued |
0.7629 | Intermediate Similarity | NPD1695 | Approved |
0.7396 | Intermediate Similarity | NPD5363 | Approved |
0.7396 | Intermediate Similarity | NPD1694 | Approved |
0.7379 | Intermediate Similarity | NPD4225 | Approved |
0.732 | Intermediate Similarity | NPD5786 | Approved |
0.73 | Intermediate Similarity | NPD6411 | Approved |
0.7263 | Intermediate Similarity | NPD5209 | Approved |
0.7263 | Intermediate Similarity | NPD6435 | Approved |
0.7158 | Intermediate Similarity | NPD5369 | Approved |
0.71 | Intermediate Similarity | NPD6101 | Approved |
0.71 | Intermediate Similarity | NPD5764 | Clinical (unspecified phase) |
0.7083 | Intermediate Similarity | NPD4269 | Approved |
0.7083 | Intermediate Similarity | NPD4270 | Approved |
0.7059 | Intermediate Similarity | NPD5779 | Approved |
0.7059 | Intermediate Similarity | NPD5778 | Approved |
0.7053 | Intermediate Similarity | NPD5368 | Approved |
0.7041 | Intermediate Similarity | NPD1733 | Clinical (unspecified phase) |
0.701 | Intermediate Similarity | NPD5362 | Discontinued |
0.701 | Intermediate Similarity | NPD7154 | Phase 3 |
0.6961 | Remote Similarity | NPD7983 | Approved |
0.6957 | Remote Similarity | NPD7115 | Discovery |
0.6909 | Remote Similarity | NPD5697 | Approved |
0.6907 | Remote Similarity | NPD4752 | Clinical (unspecified phase) |
0.6875 | Remote Similarity | NPD4252 | Approved |
0.6863 | Remote Similarity | NPD6698 | Approved |
0.6863 | Remote Similarity | NPD46 | Approved |
0.6847 | Remote Similarity | NPD6899 | Approved |
0.6847 | Remote Similarity | NPD6881 | Approved |
0.6842 | Remote Similarity | NPD5784 | Clinical (unspecified phase) |
0.6814 | Remote Similarity | NPD6649 | Approved |
0.6814 | Remote Similarity | NPD6650 | Approved |
0.6786 | Remote Similarity | NPD6012 | Approved |
0.6786 | Remote Similarity | NPD6013 | Approved |
0.6786 | Remote Similarity | NPD6014 | Approved |
0.6754 | Remote Similarity | NPD6053 | Discontinued |
0.6731 | Remote Similarity | NPD6399 | Phase 3 |
0.6726 | Remote Similarity | NPD7290 | Approved |
0.6726 | Remote Similarity | NPD6883 | Approved |
0.6726 | Remote Similarity | NPD7102 | Approved |
0.6701 | Remote Similarity | NPD5790 | Clinical (unspecified phase) |
0.67 | Remote Similarity | NPD6082 | Clinical (unspecified phase) |
0.6699 | Remote Similarity | NPD7838 | Discovery |
0.6696 | Remote Similarity | NPD7320 | Approved |
0.6696 | Remote Similarity | NPD6686 | Approved |
0.6696 | Remote Similarity | NPD6011 | Approved |
0.6667 | Remote Similarity | NPD8130 | Phase 1 |
0.6667 | Remote Similarity | NPD7128 | Approved |
0.6667 | Remote Similarity | NPD5739 | Approved |
0.6667 | Remote Similarity | NPD6847 | Approved |
0.6667 | Remote Similarity | NPD6675 | Approved |
0.6667 | Remote Similarity | NPD6869 | Approved |
0.6667 | Remote Similarity | NPD6617 | Approved |
0.6667 | Remote Similarity | NPD6402 | Approved |
0.6637 | Remote Similarity | NPD6372 | Approved |
0.6637 | Remote Similarity | NPD6373 | Approved |
0.6634 | Remote Similarity | NPD4249 | Approved |
0.6609 | Remote Similarity | NPD8297 | Approved |
0.6609 | Remote Similarity | NPD6882 | Approved |
0.6607 | Remote Similarity | NPD5701 | Approved |
0.6569 | Remote Similarity | NPD4251 | Approved |
0.6569 | Remote Similarity | NPD4250 | Approved |
0.6557 | Remote Similarity | NPD7492 | Approved |
0.6545 | Remote Similarity | NPD5211 | Phase 2 |
0.6542 | Remote Similarity | NPD7839 | Suspended |
0.6531 | Remote Similarity | NPD4822 | Approved |
0.6531 | Remote Similarity | NPD4819 | Approved |
0.6531 | Remote Similarity | NPD4821 | Approved |
0.6531 | Remote Similarity | NPD4820 | Approved |
0.6518 | Remote Similarity | NPD6008 | Approved |
0.6514 | Remote Similarity | NPD5286 | Approved |
0.6514 | Remote Similarity | NPD4696 | Approved |
0.6514 | Remote Similarity | NPD5285 | Approved |
0.6504 | Remote Similarity | NPD6616 | Approved |
0.65 | Remote Similarity | NPD6319 | Approved |
0.65 | Remote Similarity | NPD6054 | Approved |
0.6495 | Remote Similarity | NPD4271 | Approved |
0.6495 | Remote Similarity | NPD4268 | Approved |
0.6481 | Remote Similarity | NPD6084 | Phase 2 |
0.6481 | Remote Similarity | NPD7902 | Approved |
0.6481 | Remote Similarity | NPD6083 | Phase 2 |
0.6476 | Remote Similarity | NPD7637 | Suspended |
0.6476 | Remote Similarity | NPD6079 | Approved |
0.6452 | Remote Similarity | NPD7078 | Approved |
0.6449 | Remote Similarity | NPD5695 | Phase 3 |
0.6446 | Remote Similarity | NPD6291 | Clinical (unspecified phase) |
0.6446 | Remote Similarity | NPD6016 | Approved |
0.6446 | Remote Similarity | NPD6015 | Approved |
0.6429 | Remote Similarity | NPD5141 | Approved |
0.6422 | Remote Similarity | NPD7638 | Approved |
0.6422 | Remote Similarity | NPD5696 | Approved |
0.6404 | Remote Similarity | NPD5345 | Clinical (unspecified phase) |
0.64 | Remote Similarity | NPD7736 | Approved |
0.6396 | Remote Similarity | NPD5226 | Approved |
0.6396 | Remote Similarity | NPD5225 | Approved |
0.6396 | Remote Similarity | NPD4633 | Approved |
0.6396 | Remote Similarity | NPD5224 | Approved |
0.6393 | Remote Similarity | NPD5988 | Approved |
0.6393 | Remote Similarity | NPD6370 | Approved |
0.6389 | Remote Similarity | NPD5222 | Approved |
0.6389 | Remote Similarity | NPD5221 | Approved |
0.6389 | Remote Similarity | NPD5220 | Clinical (unspecified phase) |
0.6364 | Remote Similarity | NPD7639 | Approved |
0.6364 | Remote Similarity | NPD7640 | Approved |
0.6355 | Remote Similarity | NPD7748 | Approved |
0.6346 | Remote Similarity | NPD6903 | Approved |
0.6339 | Remote Similarity | NPD5175 | Approved |
0.6339 | Remote Similarity | NPD5174 | Approved |
0.6337 | Remote Similarity | NPD5332 | Approved |
0.6337 | Remote Similarity | NPD5331 | Approved |
0.633 | Remote Similarity | NPD5173 | Approved |
0.633 | Remote Similarity | NPD4755 | Approved |
0.6321 | Remote Similarity | NPD7515 | Phase 2 |
0.6321 | Remote Similarity | NPD5284 | Approved |
0.6321 | Remote Similarity | NPD5281 | Approved |
0.6311 | Remote Similarity | NPD8515 | Approved |
0.6311 | Remote Similarity | NPD8513 | Phase 3 |
0.6311 | Remote Similarity | NPD7521 | Approved |
0.6311 | Remote Similarity | NPD7146 | Approved |
0.6311 | Remote Similarity | NPD7334 | Approved |
0.6311 | Remote Similarity | NPD5330 | Approved |
0.6311 | Remote Similarity | NPD3618 | Phase 1 |
0.6311 | Remote Similarity | NPD6409 | Approved |
0.6311 | Remote Similarity | NPD6684 | Approved |
0.6311 | Remote Similarity | NPD8516 | Approved |
0.6311 | Remote Similarity | NPD8517 | Approved |
0.6306 | Remote Similarity | NPD5223 | Approved |
0.6303 | Remote Similarity | NPD6274 | Approved |
0.63 | Remote Similarity | NPD4790 | Discontinued |
0.6296 | Remote Similarity | NPD5210 | Approved |
0.6296 | Remote Similarity | NPD4629 | Approved |
0.6293 | Remote Similarity | NPD4634 | Approved |
0.6286 | Remote Similarity | NPD5328 | Approved |
0.6286 | Remote Similarity | NPD5370 | Suspended |
0.6281 | Remote Similarity | NPD7100 | Approved |
0.6281 | Remote Similarity | NPD7101 | Approved |
0.6275 | Remote Similarity | NPD3133 | Approved |
0.6275 | Remote Similarity | NPD3666 | Approved |
0.6275 | Remote Similarity | NPD6400 | Clinical (unspecified phase) |
0.6275 | Remote Similarity | NPD3665 | Phase 1 |
0.6273 | Remote Similarity | NPD8029 | Clinical (unspecified phase) |
0.6271 | Remote Similarity | NPD4632 | Approved |
0.625 | Remote Similarity | NPD3573 | Approved |
0.625 | Remote Similarity | NPD6317 | Approved |
0.6239 | Remote Similarity | NPD4697 | Phase 3 |
0.6239 | Remote Similarity | NPD6401 | Clinical (unspecified phase) |
0.6239 | Remote Similarity | NPD8413 | Clinical (unspecified phase) |
0.6238 | Remote Similarity | NPD4800 | Clinical (unspecified phase) |
0.6238 | Remote Similarity | NPD3667 | Approved |
0.623 | Remote Similarity | NPD6059 | Approved |
0.6226 | Remote Similarity | NPD5207 | Approved |
0.622 | Remote Similarity | NPD7319 | Approved |
0.6216 | Remote Similarity | NPD4700 | Approved |
0.6204 | Remote Similarity | NPD7900 | Approved |
0.6204 | Remote Similarity | NPD7901 | Clinical (unspecified phase) |
0.62 | Remote Similarity | NPD4695 | Discontinued |
0.6198 | Remote Similarity | NPD6314 | Approved |
0.6198 | Remote Similarity | NPD6335 | Approved |
0.6198 | Remote Similarity | NPD6313 | Approved |
0.619 | Remote Similarity | NPD7513 | Clinical (unspecified phase) |
0.619 | Remote Similarity | NPD8293 | Discontinued |
0.619 | Remote Similarity | NPD6672 | Approved |
0.619 | Remote Similarity | NPD5737 | Approved |
0.6186 | Remote Similarity | NPD8039 | Approved |
0.6168 | Remote Similarity | NPD4810 | Clinical (unspecified phase) |
0.6168 | Remote Similarity | NPD5693 | Phase 1 |
0.6167 | Remote Similarity | NPD6868 | Approved |
0.6161 | Remote Similarity | NPD5344 | Discontinued |
0.6154 | Remote Similarity | NPD5279 | Phase 3 |
0.6154 | Remote Similarity | NPD3574 | Clinical (unspecified phase) |
0.6147 | Remote Similarity | NPD6356 | Clinical (unspecified phase) |
0.6132 | Remote Similarity | NPD4753 | Phase 2 |
0.6124 | Remote Similarity | NPD7260 | Phase 2 |
0.6121 | Remote Similarity | NPD4729 | Approved |
0.6121 | Remote Similarity | NPD4730 | Approved |
0.6117 | Remote Similarity | NPD4786 | Approved |
0.6116 | Remote Similarity | NPD6009 | Approved |
0.6111 | Remote Similarity | NPD7507 | Approved |
0.608 | Remote Similarity | NPD8328 | Phase 3 |
0.608 | Remote Similarity | NPD7642 | Approved |
0.6068 | Remote Similarity | NPD4061 | Clinical (unspecified phase) |
0.6063 | Remote Similarity | NPD8074 | Phase 3 |
0.6058 | Remote Similarity | NPD1696 | Phase 3 |
0.6048 | Remote Similarity | NPD5983 | Phase 2 |
0.6034 | Remote Similarity | NPD6412 | Phase 2 |
0.6022 | Remote Similarity | NPD7331 | Phase 2 |
0.6017 | Remote Similarity | NPD5250 | Approved |
0.6017 | Remote Similarity | NPD5251 | Approved |
0.6017 | Remote Similarity | NPD5955 | Clinical (unspecified phase) |
0.6017 | Remote Similarity | NPD5249 | Phase 3 |
0.6017 | Remote Similarity | NPD5248 | Approved |
0.6017 | Remote Similarity | NPD5247 | Approved |
0.6015 | Remote Similarity | NPD7966 | Clinical (unspecified phase) |
0.6 | Remote Similarity | NPD4519 | Discontinued |
0.6 | Remote Similarity | NPD4623 | Approved |
0.5983 | Remote Similarity | NPD5128 | Approved |
Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.