Drug Information| Drug ID:   | NPD984 |
| Drug Name:   | Ceftizoxime Sodium |
| Molecular Formula:   | C13H13N5O5S2.Na |
| Canonical SMILES:   | [O-]C(=N[C@H]1[C@H]2SCC=C(N2C1=O)C(=O)O)/C(=NOC)/c1csc(=N)[nH]1.[Na+] |
| Standard InCHI:   | "InChI=1S/C13H13N5O5S2.Na/c1-23-17-7(5-4-25-13(14)15-5)9(19)16-8-10(20)18-6(12(21)22)2-3-24-11(8)18;/h2,4,8,11H,3H2,1H3,(H2,14,15)(H,16,19)(H,21,22);/q;+1/p-1/b17-7-;/t8-,11-;/m1./s1" |
| Standard InCHIKey:   | ADLFUPFRVXCDMO-LIGXYSTNSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD984Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 382.03 |
| ALogP   | -1.0607 |
| MLogP   | 1.57 |
| XLogP   | 1.236 |
| HDA   | 8 |
| HBD   | 3 |
| Rotatable Bonds   | 8 |
| TPSA   | 201.1 |
| RO5 Violation   | 0 |