NPASS drugs

Drug Information

Drug ID:	NPD982
Drug Name:	Cefacetrile
Molecular Formula:	C13H13N3O6S
Canonical SMILES:	CC(=O)OCC1=C(N2[C@H](SC1)[C@@H](C2=O)N=C(CC#N)O)C(=O)O
Standard InCHI:	"InChI=1S/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1"
Standard InCHIKey:	RRYMAQUWDLIUPV-BXKDBHETSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD; DrugBank

Structural Similarity Between NPASS Natural Products and NPD982

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	81096
0.1-0.2	126628
0.2-0.3	3962
0.3-0.4	32
0.4-0.5	8
0.5-0.6	10
0.6-0.7	2
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7458	NPC157603
Intermediate Similarity	0.7333	NPC64758
Remote Similarity	0.6984	NPC270750
Remote Similarity	0.6984	NPC165659
Remote Similarity	0.5857	NPC487959
Remote Similarity	0.5806	NPC144780
Remote Similarity	0.5714	NPC237688
Remote Similarity	0.5694	NPC481259
Remote Similarity	0.5676	NPC478434
Remote Similarity	0.5493	NPC261892
Remote Similarity	0.5455	NPC272853
Remote Similarity	0.5455	NPC278687
Remote Similarity	0.5373	NPC40287
Remote Similarity	0.5373	NPC289632

Drug Structure

NPD982 OpenBabel08201723592D 25 26 0 0 1 0 0 0 0 0999 V2000 3.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8978 -0.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8637 0.0353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -1.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 8 1 0 0 0 0 3 14 3 0 0 0 0 4 7 1 0 0 0 0 4 22 1 0 0 0 0 5 7 1 0 0 0 0 5 23 1 0 0 0 0 6 17 2 0 0 0 0 6 22 1 0 0 0 0 7 10 2 0 0 0 0 8 15 2 3 0 0 0 8 18 1 0 0 0 0 9 11 1 0 0 0 0 9 12 1 0 0 0 0 9 15 1 6 0 0 0 10 13 1 0 0 0 0 10 16 1 0 0 0 0 11 16 1 0 0 0 0 11 19 2 0 0 0 0 12 16 1 0 0 0 0 12 23 1 6 0 0 0 13 20 2 0 0 0 0 13 21 1 0 0 0 0 18 24 1 0 0 0 0 21 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001172
DrugBank	DB01414
ChEMBL	CHEMBL2110602
IUPHAR/BPS
PharmaGKB	PA164776752
KEGG Drug	D07629
PubChem CID	91562
ChEBI	135437
CAS Number	10206-21-0

Drug Properties

Molecular Weight	339.05
ALogP	-0.5536
MLogP	1.79
XLogP	-1.731
HDA	9
HBD	2
Rotatable Bonds	9
TPSA	165.59
RO5 Violation	0