Drug Information| Drug ID:   | NPD9764 |
| Drug Name:   | Guanidine Hydrochloride |
| Molecular Formula:   | CH5N3.ClH |
| Canonical SMILES:   | NC(=N)N.Cl |
| Standard InCHI:   | "InChI=1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H" |
| Standard InCHIKey:   | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9764Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8571 | NPC20535 |
| High Similarity | 0.8571 | NPC17312 |
| High Similarity | 0.8571 | NPC611219 |
| Remote Similarity | 0.6 | NPC183737 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 59.05 |
| ALogP   | -0.4695 |
| MLogP   | 1.24 |
| XLogP   | -0.646 |
| HDA   | 3 |
| HBD   | 3 |
| Rotatable Bonds   | 2 |
| TPSA   | 75.89 |
| RO5 Violation   | 0 |