Drug Information| Drug ID:   | NPD9748 |
| Drug Name:   | Sodium Bicarbonate |
| Molecular Formula:   | CH2O3.Na |
| Canonical SMILES:   | [O-]C(=O)O.[Na+] |
| Standard InCHI:   | "InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1" |
| Standard InCHIKey:   | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9748Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.875 | NPC327796 |
| Remote Similarity | 0.6364 | NPC184782 |
| Remote Similarity | 0.6 | NPC150958 |
| Remote Similarity | 0.6 | NPC68873 |
| Remote Similarity | 0.6 | NPC323500 |
| Remote Similarity | 0.5556 | NPC300325 |
| Remote Similarity | 0.5556 | NPC251720 |
| Remote Similarity | 0.5556 | NPC159900 |
| Remote Similarity | 0.5556 | NPC8159 |
| Remote Similarity | 0.5556 | NPC606409 |
| Molecular Weight   | 60.99 |
| ALogP   | -0.5155 |
| MLogP   | 1.24 |
| XLogP   | -0.711 |
| HDA   | 3 |
| HBD   | 1 |
| Rotatable Bonds   | 2 |
| TPSA   | 60.36 |
| RO5 Violation   | 0 |