Drug Information| Drug ID: | NPD9748 |
| Drug Name: | Sodium Bicarbonate |
| Molecular Formula: | CH2O3.Na |
| Canonical SMILES: | [O-]C(=O)O.[Na+] |
| Standard InCHI: | InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| Standard InCHIKey: | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9748Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC327795 |
| Remote Similarity | 0.6154 | NPC159900 |
| Remote Similarity | 0.5714 | NPC300325 |
| Molecular Weight | 60.99 |
| ALogP | -0.5155 |
| MLogP | 1.24 |
| XLogP | -0.711 |
| HDA | 3 |
| HBD | 1 |
| Rotatable Bonds | 2 |
| TPSA | 60.36 |
| RO5 Violation | 0 |