Drug Information| Drug ID:   | NPD9742 |
| Drug Name:   | Dihydroxialumini Carbonate |
| Molecular Formula:   | CH2O3.Al.2H2O |
| Canonical SMILES:   | [O-]C(=O)[O-].O.[OH-].[Al+3] |
| Standard InCHI:   | "InChI=1S/CH2O3.Al.2H2O/c2-1(3)4;;;/h(H2,2,3,4);;2*1H2/q;+3;;/p-3" |
| Standard InCHIKey:   | KVOLEYCISIIDBJ-UHFFFAOYSA-K |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9742Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8333 | NPC145466 |
| Intermediate Similarity | 0.7143 | NPC251720 |
| Remote Similarity | 0.625 | NPC68874 |
| Remote Similarity | 0.625 | NPC327795 |
| Remote Similarity | 0.5714 | NPC317063 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 59.98 |
| ALogP   | -1.1933 |
| MLogP   | 1.24 |
| XLogP   | -1.192 |
| HDA   | 3 |
| HBD   | 0 |
| Rotatable Bonds   | 2 |
| TPSA   | 63.19 |
| RO5 Violation   | 0 |