Drug Information| Drug ID:   | NPD9727 |
| Drug Name:   | Methenamine Hippurate |
| Molecular Formula:   | C9H9NO3.C6H12N4 |
| Canonical SMILES:   | C1N2CN3CN1CN(C2)C3.OC(=NCC(=O)O)c1ccccc1 |
| Standard InCHI:   | "InChI=1S/C9H9NO3.C6H12N4/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-5H,6H2,(H,10,13)(H,11,12);1-6H2" |
| Standard InCHIKey:   | ROAIXOJGRFKICW-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9727Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8 | NPC3371 |
| Intermediate Similarity | 0.8 | NPC274032 |
| Remote Similarity | 0.5682 | NPC163674 |
| Remote Similarity | 0.5476 | NPC318154 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 140.11 |
| ALogP   | 0.0858 |
| MLogP   | 1.68 |
| XLogP   | -0.186 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 0 |
| TPSA   | 12.96 |
| RO5 Violation   | 0 |