NPASS drugs

Drug Information

Drug ID:	NPD965
Drug Name:	Nimesulide
Molecular Formula:	C13H12N2O5S
Canonical SMILES:	O=N(=O)c1ccc(c(c1)Oc1ccccc1)NS(=O)(=O)C
Standard InCHI:	InChI=1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3
Standard InCHIKey:	HYWYRSMBCFDLJT-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD965

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	276
0.1-0.2	6131
0.2-0.3	7289
0.3-0.4	7696
0.4-0.5	8879
0.5-0.6	584
0.6-0.7	33
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7537	NPC226914
Intermediate Similarity	0.716	NPC473432
Remote Similarity	0.6908	NPC208022
Remote Similarity	0.6824	NPC315632
Remote Similarity	0.6811	NPC111492
Remote Similarity	0.6761	NPC322735
Remote Similarity	0.6753	NPC297584
Remote Similarity	0.6599	NPC321869
Remote Similarity	0.6597	NPC329190
Remote Similarity	0.6594	NPC256838
Remote Similarity	0.6582	NPC476475
Remote Similarity	0.6558	NPC473987
Remote Similarity	0.6528	NPC264782
Remote Similarity	0.6522	NPC168750
Remote Similarity	0.646	NPC476462
Remote Similarity	0.6454	NPC44836
Remote Similarity	0.6434	NPC9336
Remote Similarity	0.6434	NPC329358
Remote Similarity	0.6403	NPC311660
Remote Similarity	0.638	NPC260601
Remote Similarity	0.6364	NPC73280
Remote Similarity	0.6347	NPC40209
Remote Similarity	0.6303	NPC473769
Remote Similarity	0.625	NPC255721
Remote Similarity	0.6154	NPC118776
Remote Similarity	0.6102	NPC1527
Remote Similarity	0.6098	NPC314113
Remote Similarity	0.6092	NPC306366
Remote Similarity	0.6087	NPC317872
Remote Similarity	0.608	NPC471532
Remote Similarity	0.6066	NPC288305
Remote Similarity	0.6048	NPC473874
Remote Similarity	0.6028	NPC70201
Remote Similarity	0.6012	NPC112766
Remote Similarity	0.6	NPC231862
Remote Similarity	0.5989	NPC469830
Remote Similarity	0.5957	NPC110741
Remote Similarity	0.594	NPC125306
Remote Similarity	0.5899	NPC204179
Remote Similarity	0.589	NPC76327
Remote Similarity	0.5886	NPC70549
Remote Similarity	0.5882	NPC471531
Remote Similarity	0.5879	NPC469828
Remote Similarity	0.5876	NPC57105
Remote Similarity	0.5866	NPC314861
Remote Similarity	0.5866	NPC127362
Remote Similarity	0.5859	NPC473422
Remote Similarity	0.5847	NPC290069
Remote Similarity	0.5838	NPC219383
Remote Similarity	0.5829	NPC315257
Remote Similarity	0.5829	NPC469829
Remote Similarity	0.5821	NPC471561
Remote Similarity	0.5819	NPC285635
Remote Similarity	0.5815	NPC220560
Remote Similarity	0.5802	NPC313466
Remote Similarity	0.5775	NPC313918
Remote Similarity	0.5771	NPC206372
Remote Similarity	0.5771	NPC203424
Remote Similarity	0.5762	NPC26524
Remote Similarity	0.5759	NPC473008
Remote Similarity	0.5743	NPC477825
Remote Similarity	0.5739	NPC10875
Remote Similarity	0.5739	NPC10730
Remote Similarity	0.5733	NPC21890
Remote Similarity	0.5722	NPC299582
Remote Similarity	0.5714	NPC323948
Remote Similarity	0.5707	NPC95898
Remote Similarity	0.5707	NPC470586
Remote Similarity	0.5692	NPC470023
Remote Similarity	0.569	NPC322283
Remote Similarity	0.5686	NPC222982
Remote Similarity	0.5683	NPC258773
Remote Similarity	0.5682	NPC320751
Remote Similarity	0.5676	NPC8467
Remote Similarity	0.5669	NPC318357
Remote Similarity	0.5667	NPC95977
Remote Similarity	0.5663	NPC122542
Remote Similarity	0.5663	NPC470021
Remote Similarity	0.5659	NPC477827
Remote Similarity	0.5659	NPC477826
Remote Similarity	0.5655	NPC47986
Remote Similarity	0.5652	NPC225381
Remote Similarity	0.5646	NPC42383
Remote Similarity	0.5645	NPC315631
Remote Similarity	0.5641	NPC230313
Remote Similarity	0.5641	NPC243626
Remote Similarity	0.5638	NPC97811
Remote Similarity	0.5632	NPC313886
Remote Similarity	0.5615	NPC316161
Remote Similarity	0.5612	NPC108847
Remote Similarity	0.5611	NPC177404
Remote Similarity	0.5608	NPC469831
Remote Similarity	0.5605	NPC41801

Drug Structure

NPD965 OpenBabel08201723592D 22 23 0 0 0 0 0 0 0 0999 V2000 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 3.4641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 4.3301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 21 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 2 0 0 0 0 5 11 2 0 0 0 0 6 11 1 0 0 0 0 7 8 2 0 0 0 0 7 10 1 0 0 0 0 8 12 1 0 0 0 0 9 10 2 0 0 0 0 9 13 1 0 0 0 0 10 15 1 0 0 0 0 11 20 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 20 1 0 0 0 0 14 21 1 0 0 0 0 14 22 1 0 0 0 0 15 16 2 0 0 0 0 15 17 2 0 0 0 0 18 21 2 0 0 0 0 19 21 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC003303; DCL000518; DPR000079
DrugBank	DB04743
ChEMBL	CHEMBL56367
IUPHAR/BPS	7401
PharmaGKB	PA137179528
KEGG Drug	D01049
PubChem CID	4495
ChEBI	44445
CAS Number	51803-78-2

Drug Properties

Molecular Weight	308.05
ALogP	-0.3282
MLogP	2.01
XLogP	3.736
HDA	3
HBD	1
Rotatable Bonds	7
TPSA	106.92
RO5 Violation	0