Drug Information| Drug ID:   | NPD9620 |
| Drug Name:   | |
| Molecular Formula:   | C9H13NO3 |
| Canonical SMILES:   | CNCC(c1ccc(c(c1)O)O)O |
| Standard InCHI:   | "InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3" |
| Standard InCHIKey:   | UCTWMZQNUQWSLP-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD9620Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC323775 |
| High Similarity | 1.0 | NPC236347 |
| High Similarity | 1.0 | NPC599888 |
| High Similarity | 1.0 | NPC611709 |
| Intermediate Similarity | 0.7353 | NPC483291 |
| Intermediate Similarity | 0.7353 | NPC611998 |
| Intermediate Similarity | 0.7333 | NPC118522 |
| Intermediate Similarity | 0.7333 | NPC115627 |
| Intermediate Similarity | 0.7333 | NPC169207 |
| Intermediate Similarity | 0.7333 | NPC599811 |
| Intermediate Similarity | 0.7333 | NPC602688 |
| Remote Similarity | 0.6875 | NPC124830 |
| Remote Similarity | 0.6875 | NPC213 |
| Remote Similarity | 0.6875 | NPC10286 |
| Remote Similarity | 0.6875 | NPC604424 |
| Remote Similarity | 0.6875 | NPC609563 |
| Remote Similarity | 0.6765 | NPC137096 |
| Remote Similarity | 0.6765 | NPC612014 |
| Remote Similarity | 0.55 | NPC141126 |
| Remote Similarity | 0.5455 | NPC84225 |
| Remote Similarity | 0.5455 | NPC327226 |
| Remote Similarity | 0.5455 | NPC503351 |
| Remote Similarity | 0.5366 | NPC302468 |
| Remote Similarity | 0.5366 | NPC321199 |
| Remote Similarity | 0.5143 | NPC325793 |
| Molecular Weight   | 183.09 |
| ALogP   | -1.7378 |
| MLogP   | 2.01 |
| XLogP   | -0.07 |
| HDA   | 2 |
| HBD   | 4 |
| Rotatable Bonds   | 7 |
| TPSA   | 72.72 |
| RO5 Violation   | 0 |