Drug Information| Drug ID:   | NPD9616 |
| Drug Name:   | Phenylephrine |
| Molecular Formula:   | C9H13NO2 |
| Canonical SMILES:   | CNC[C@@H](c1cccc(c1)O)O |
| Standard InCHI:   | "InChI=1S/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1" |
| Standard InCHIKey:   | SONNWYBIRXJNDC-VIFPVBQESA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD9616Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC137096 |
| High Similarity | 1.0 | NPC612014 |
| Remote Similarity | 0.6765 | NPC323775 |
| Remote Similarity | 0.6765 | NPC236347 |
| Remote Similarity | 0.6765 | NPC599888 |
| Remote Similarity | 0.6765 | NPC611709 |
| Remote Similarity | 0.6667 | NPC124830 |
| Remote Similarity | 0.6667 | NPC213 |
| Remote Similarity | 0.6667 | NPC10286 |
| Remote Similarity | 0.6667 | NPC604424 |
| Remote Similarity | 0.6667 | NPC609563 |
| Remote Similarity | 0.625 | NPC327226 |
| Remote Similarity | 0.625 | NPC503351 |
| TTD   | DAP000224; DIB013991 |
| DrugBank   | DB00388 |
| ChEMBL   | CHEMBL1215 |
| IUPHAR/BPS   | 485 |
| PharmaGKB   | PA450935 |
| KEGG Drug   | |
| PubChem CID   | 6041 |
| ChEBI   | 8093 |
| CAS Number   | 59-42-7 |
| Molecular Weight   | 167.09 |
| ALogP   | -1.2775 |
| MLogP   | 2.12 |
| XLogP   | 0.464 |
| HDA   | 2 |
| HBD   | 3 |
| Rotatable Bonds   | 6 |
| TPSA   | 52.49 |
| RO5 Violation   | 0 |