NPASS drugs

Drug Information

Drug ID:	NPD9613
Drug Name:	Phenylephrine Bitartrate
Molecular Formula:	C9H13NO2.C4H6O6
Canonical SMILES:	OC(C(C(=O)O)O)C(=O)O.CNC[C@@H](c1cccc(c1)O)O
Standard InCHI:	"InChI=1S/C9H13NO2.C4H6O6/c1-10-6-9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-5,9-12H,6H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t9-;/m0./s1"
Standard InCHIKey:	NHKOTKKHHYKARN-FVGYRXGTSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD9613

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	122091
0.1-0.2	84920
0.2-0.3	4544
0.3-0.4	152
0.4-0.5	19
0.5-0.6	12
0.6-0.7	0
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7436	NPC137096
Intermediate Similarity	0.7436	NPC612014
Remote Similarity	0.587	NPC141126
Remote Similarity	0.549	NPC328253
Remote Similarity	0.5435	NPC327590
Remote Similarity	0.5227	NPC323775
Remote Similarity	0.5227	NPC236347
Remote Similarity	0.5227	NPC599888
Remote Similarity	0.5227	NPC611709
Remote Similarity	0.5116	NPC124830
Remote Similarity	0.5116	NPC213
Remote Similarity	0.5116	NPC10286
Remote Similarity	0.5116	NPC604424
Remote Similarity	0.5116	NPC609563

Drug Structure

NPD9613 OpenBabel08211713452D 29 28 0 0 1 0 0 0 0 0999 V2000 4.8301 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -3.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8301 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1603 -2.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 9.2942 -2.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 11.0263 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1603 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2942 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0263 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8923 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -4.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0263 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1603 -4.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8923 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 10 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 7 1 0 0 0 0 4 8 2 0 0 0 0 5 7 2 0 0 0 0 5 8 1 0 0 0 0 6 10 1 0 0 0 0 7 9 1 0 0 0 0 8 11 1 0 0 0 0 9 6 1 6 0 0 0 9 12 1 0 0 0 0 10 23 1 0 0 0 0 11 24 1 0 0 0 0 12 25 1 0 0 0 0 13 14 1 0 0 0 0 13 15 1 0 0 0 0 13 17 1 0 0 0 0 14 16 1 0 0 0 0 14 18 1 0 0 0 0 15 19 2 0 0 0 0 15 20 1 0 0 0 0 16 21 2 0 0 0 0 16 22 1 0 0 0 0 17 26 1 0 0 0 0 18 27 1 0 0 0 0 20 28 1 0 0 0 0 22 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	167.09
ALogP	-1.2775
MLogP	2.12
XLogP	0.464
HDA	2
HBD	3
Rotatable Bonds	6
TPSA	52.49
RO5 Violation	0