Drug Information| Drug ID:   | NPD9612 |
| Drug Name:   | Phenylpropanolamine |
| Molecular Formula:   | C9H13NO |
| Canonical SMILES:   | O[C@@H](c1ccccc1)[C@H](N)C |
| Standard InCHI:   | "InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9-/m1/s1" |
| Standard InCHIKey:   | DLNKOYKMWOXYQA-VXNVDRBHSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD9612Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC164514 |
| High Similarity | 1.0 | NPC303611 |
| High Similarity | 1.0 | NPC108606 |
| High Similarity | 1.0 | NPC199972 |
| High Similarity | 1.0 | NPC603328 |
| High Similarity | 1.0 | NPC611672 |
| Remote Similarity | 0.6667 | NPC147000 |
| Remote Similarity | 0.6667 | NPC226778 |
| Remote Similarity | 0.6667 | NPC304078 |
| Remote Similarity | 0.6667 | NPC304761 |
| Remote Similarity | 0.6667 | NPC286400 |
| Remote Similarity | 0.6667 | NPC599866 |
| Remote Similarity | 0.6667 | NPC606653 |
| Remote Similarity | 0.6667 | NPC607075 |
| Remote Similarity | 0.6667 | NPC611822 |
| Remote Similarity | 0.6429 | NPC150254 |
| Remote Similarity | 0.6364 | NPC103326 |
| Remote Similarity | 0.6364 | NPC99394 |
| Remote Similarity | 0.6364 | NPC87299 |
| Remote Similarity | 0.5769 | NPC215351 |
| Remote Similarity | 0.5769 | NPC20142 |
| Remote Similarity | 0.5769 | NPC136407 |
| Remote Similarity | 0.5385 | NPC329319 |
| Remote Similarity | 0.5385 | NPC162419 |
| Remote Similarity | 0.5385 | NPC519509 |
| Remote Similarity | 0.5185 | NPC262471 |
| Remote Similarity | 0.5185 | NPC324746 |
| TTD   | DNC001144; DAP000899; DNC000815 |
| DrugBank   | DB00397 |
| ChEMBL   | CHEMBL2092846 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164748965 |
| KEGG Drug   | |
| PubChem CID   | 26934 |
| ChEBI   | 36 |
| CAS Number   | 14838-15-4 |
| Molecular Weight   | 151.1 |
| ALogP   | -1.2597 |
| MLogP   | 2.23 |
| XLogP   | 2.13 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 5 |
| TPSA   | 46.25 |
| RO5 Violation   | 0 |