NPASS drugs

Drug Information

Drug ID:	NPD9604
Drug Name:	Cytarabine
Molecular Formula:	C9H13N3O5
Canonical SMILES:	OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1ccc(=N)nc1O
Standard InCHI:	"InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1"
Standard InCHIKey:	UHDGCWIWMRVCDJ-CCXZUQQUSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD9604

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	117670
0.1-0.2	91518
0.2-0.3	2376
0.3-0.4	125
0.4-0.5	30
0.5-0.6	11
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC62927
Remote Similarity	0.6604	NPC226769
Remote Similarity	0.6531	NPC229249
Remote Similarity	0.6531	NPC140420
Remote Similarity	0.64	NPC328806
Remote Similarity	0.6275	NPC480848
Remote Similarity	0.6	NPC6166
Remote Similarity	0.6	NPC487916
Remote Similarity	0.5932	NPC120887
Remote Similarity	0.5714	NPC280946
Remote Similarity	0.5645	NPC328779
Remote Similarity	0.5645	NPC240517
Remote Similarity	0.5645	NPC129
Remote Similarity	0.5606	NPC65200
Remote Similarity	0.5606	NPC295073
Remote Similarity	0.5455	NPC126704
Remote Similarity	0.5357	NPC310803
Remote Similarity	0.5094	NPC469972
Remote Similarity	0.5082	NPC90240

Drug Structure

NPD9604 OpenBabel08211713452D 22 23 0 0 1 0 0 0 0 0999 V2000 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4432 0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 0.8364 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9487 1.7024 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9706 1.4945 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.0310 1.5409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3554 2.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2274 2.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7796 0.0933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6243 2.4544 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7677 3.4250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4353 3.1418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 5 1 0 0 0 0 2 12 1 0 0 0 0 3 13 1 0 0 0 0 4 3 1 6 0 0 0 4 6 1 0 0 0 0 4 17 1 0 0 0 0 5 10 2 0 0 0 0 5 11 1 0 0 0 0 6 7 1 0 0 0 0 6 14 1 1 0 0 0 7 8 1 0 0 0 0 7 15 1 6 0 0 0 8 12 1 6 0 0 0 8 17 1 0 0 0 0 9 11 2 0 0 0 0 9 12 1 0 0 0 0 9 16 1 0 0 0 0 10 18 1 0 0 0 0 13 19 1 0 0 0 0 14 20 1 0 0 0 0 15 21 1 0 0 0 0 16 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC001551; DAP000644
DrugBank	DB00987
ChEMBL	CHEMBL803
IUPHAR/BPS	4827
PharmaGKB	PA449177
KEGG Drug	D00168
PubChem CID	6253
ChEBI	28680
CAS Number	147-94-4

Drug Properties

Molecular Weight	243.09
ALogP	-2.3883
MLogP	1.57
XLogP	-0.606
HDA	8
HBD	5
Rotatable Bonds	6
TPSA	129.6
RO5 Violation	0