NPASS drugs

Drug Information

Drug ID:	NPD9602
Drug Name:	Cytarabine Hydrochloride
Molecular Formula:	C9H13N3O5.ClH
Canonical SMILES:	OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1ccc(=N)nc1O.Cl
Standard InCHI:	"InChI=1S/C9H13N3O5.ClH/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8;/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16);1H/t4-,6-,7+,8-;/m1./s1"
Standard InCHIKey:	KCURWTAZOZXKSJ-JBMRGDGGSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD9602

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	117018
0.1-0.2	92390
0.2-0.3	2158
0.3-0.4	126
0.4-0.5	29
0.5-0.6	11
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9756	NPC62927
Remote Similarity	0.6481	NPC226769
Remote Similarity	0.6471	NPC480848
Remote Similarity	0.64	NPC229249
Remote Similarity	0.64	NPC140420
Remote Similarity	0.6275	NPC328806
Remote Similarity	0.5893	NPC6166
Remote Similarity	0.5882	NPC487916
Remote Similarity	0.5833	NPC120887
Remote Similarity	0.5614	NPC280946
Remote Similarity	0.5556	NPC328779
Remote Similarity	0.5556	NPC240517
Remote Similarity	0.5556	NPC129
Remote Similarity	0.5522	NPC65200
Remote Similarity	0.5522	NPC295073
Remote Similarity	0.5373	NPC126704
Remote Similarity	0.5263	NPC310803

Drug Structure

NPD9602 OpenBabel08211713452D 23 23 0 0 1 0 0 0 0 0999 V2000 6.2631 -3.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3970 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0878 -3.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0823 -3.0886 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2631 -4.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5823 -2.2226 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5605 -2.4305 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6650 -3.4250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5310 -4.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1291 -5.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.3970 -5.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5310 -3.9250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -2.3841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1756 -1.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3036 -1.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6650 -5.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7514 -3.8317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5706 -2.5169 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7.9951 -4.9250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9067 -1.4706 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7634 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0957 -0.7832 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7990 -4.9250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 5 1 0 0 0 0 2 12 1 0 0 0 0 3 13 1 0 0 0 0 4 3 1 6 0 0 0 4 6 1 0 0 0 0 4 17 1 0 0 0 0 5 10 2 0 0 0 0 5 11 1 0 0 0 0 6 7 1 0 0 0 0 6 14 1 1 0 0 0 7 8 1 0 0 0 0 7 15 1 6 0 0 0 8 12 1 6 0 0 0 8 17 1 0 0 0 0 9 11 2 0 0 0 0 9 12 1 0 0 0 0 9 16 1 0 0 0 0 10 19 1 0 0 0 0 13 20 1 0 0 0 0 14 21 1 0 0 0 0 15 22 1 0 0 0 0 16 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	243.09
ALogP	-2.3883
MLogP	1.57
XLogP	-0.606
HDA	8
HBD	5
Rotatable Bonds	6
TPSA	129.6
RO5 Violation	0