Drug Information| Drug ID:   | NPD9558 |
| Drug Name:   | Doxifluridine |
| Molecular Formula:   | C9H11FN2O5 |
| Canonical SMILES:   | C[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cc(F)c(nc1=O)O |
| Standard InCHI:   | "InChI=1S/C9H11FN2O5/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16/h2-3,5-6,8,13-14H,1H3,(H,11,15,16)/t3-,5-,6-,8-/m1/s1" |
| Standard InCHIKey:   | ZWAOHEXOSAUJHY-ZIYNGMLESA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9558Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001503 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 18343 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 246.07 |
| ALogP   | -2.03 |
| MLogP   | 1.57 |
| XLogP   | -0.963 |
| HDA   | 7 |
| HBD   | 3 |
| Rotatable Bonds   | 6 |
| TPSA   | 102.59 |
| RO5 Violation   | 0 |