Drug Information| Drug ID:   | NPD9529 |
| Drug Name:   | Raluridine |
| Molecular Formula:   | C9H10ClFN2O4 |
| Canonical SMILES:   | OC[C@H]1O[C@H](C[C@@H]1F)n1cc(Cl)c(nc1=O)O |
| Standard InCHI:   | "InChI=1S/C9H10ClFN2O4/c10-4-2-13(9(16)12-8(4)15)7-1-5(11)6(3-14)17-7/h2,5-7,14H,1,3H2,(H,12,15,16)/t5-,6+,7+/m0/s1" |
| Standard InCHIKey:   | WKVDSZYIGHLONN-RRKCRQDMSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9529Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 264.03 |
| ALogP   | -0.9084 |
| MLogP   | 1.57 |
| XLogP   | 0.141 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 6 |
| TPSA   | 82.36 |
| RO5 Violation   | 0 |