Drug Information| Drug ID: | NPD9498 |
| Drug Name: | |
| Molecular Formula: | C8H9BrN2O |
| Canonical SMILES: | CC(=O)N=c1cc(C)[nH]cc1Br |
| Standard InCHI: | InChI=1S/C8H9BrN2O/c1-5-3-8(11-6(2)12)7(9)4-10-5/h3-4H,1-2H3,(H,10,11,12) |
| Standard InCHIKey: | OMGSODSTISOTIL-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9498Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.