NPASS drugs

Drug Information

Drug ID:	NPD9406
Drug Name:	Ribavirin
Molecular Formula:	C8H12N4O5
Canonical SMILES:	OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc(n1)C(=O)N
Standard InCHI:	InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1
Standard InCHIKey:	IWUCXVSUMQZMFG-AFCXAGJDSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD9406

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	370
0.1-0.2	20155
0.2-0.3	8983
0.3-0.4	1063
0.4-0.5	215
0.5-0.6	82
0.6-0.7	22
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6575	NPC326694
Remote Similarity	0.6486	NPC321052
Remote Similarity	0.6357	NPC61198
Remote Similarity	0.6357	NPC320818
Remote Similarity	0.6286	NPC262926
Remote Similarity	0.6268	NPC30326
Remote Similarity	0.6122	NPC156461
Remote Similarity	0.6122	NPC107374
Remote Similarity	0.6122	NPC21448
Remote Similarity	0.6099	NPC319221
Remote Similarity	0.6081	NPC164665
Remote Similarity	0.6081	NPC189068
Remote Similarity	0.6054	NPC211820
Remote Similarity	0.6054	NPC251233
Remote Similarity	0.604	NPC309832
Remote Similarity	0.604	NPC269827
Remote Similarity	0.604	NPC219313
Remote Similarity	0.6028	NPC324009
Remote Similarity	0.6027	NPC186619
Remote Similarity	0.6014	NPC274384
Remote Similarity	0.6014	NPC89147
Remote Similarity	0.6014	NPC177169
Remote Similarity	0.5987	NPC321393
Remote Similarity	0.5986	NPC315642
Remote Similarity	0.5986	NPC74306
Remote Similarity	0.5986	NPC229974
Remote Similarity	0.5973	NPC64705
Remote Similarity	0.5973	NPC232408
Remote Similarity	0.5946	NPC318590
Remote Similarity	0.5906	NPC317746
Remote Similarity	0.5882	NPC85689
Remote Similarity	0.5882	NPC185991
Remote Similarity	0.5882	NPC211025
Remote Similarity	0.585	NPC161659
Remote Similarity	0.585	NPC209525
Remote Similarity	0.5844	NPC472816
Remote Similarity	0.5844	NPC321814
Remote Similarity	0.5806	NPC302778
Remote Similarity	0.5806	NPC164952
Remote Similarity	0.5806	NPC130586
Remote Similarity	0.5806	NPC212551
Remote Similarity	0.5772	NPC314152
Remote Similarity	0.5769	NPC174802
Remote Similarity	0.5743	NPC317821
Remote Similarity	0.5732	NPC224076
Remote Similarity	0.5696	NPC226245
Remote Similarity	0.5696	NPC239737
Remote Similarity	0.5696	NPC316618
Remote Similarity	0.5686	NPC121222
Remote Similarity	0.5641	NPC207633

Drug Structure

NPD9406 OpenBabel08211713352D 22 23 0 0 1 0 0 0 0 0999 V2000 3.5009 0.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7431 -0.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5873 -0.0388 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3794 -1.0169 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3849 -1.1215 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0704 1.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4013 0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9781 -0.2079 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7614 2.5032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.6092 -0.1691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.4067 0.9135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.3099 -0.2198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0485 -1.7601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8849 -1.9875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0485 1.3443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7213 0.4612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7832 2.7111 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4305 3.2464 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2234 0.1869 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0267 -1.5522 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1151 -1.9875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 13 1 0 0 0 0 2 10 2 0 0 0 0 2 12 1 0 0 0 0 3 1 1 6 0 0 0 3 4 1 0 0 0 0 3 17 1 0 0 0 0 4 5 1 0 0 0 0 4 14 1 1 0 0 0 5 8 1 0 0 0 0 5 15 1 1 0 0 0 6 7 1 0 0 0 0 6 9 1 0 0 0 0 6 16 2 0 0 0 0 7 10 1 0 0 0 0 7 11 2 0 0 0 0 8 12 1 6 0 0 0 8 17 1 0 0 0 0 9 18 1 0 0 0 0 9 19 1 0 0 0 0 11 12 1 0 0 0 0 13 20 1 0 0 0 0 14 21 1 0 0 0 0 15 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC001210; DAP000173
DrugBank	DB00811
ChEMBL	CHEMBL1643
IUPHAR/BPS	6842
PharmaGKB	PA451241
KEGG Drug	D00423
PubChem CID	37542
ChEBI	63580
CAS Number	36791-04-5

Drug Properties

Molecular Weight	244.08
ALogP	-2.164
MLogP	1.35
XLogP	-3.044
HDA	9
HBD	4
Rotatable Bonds	7
TPSA	143.72
RO5 Violation	0