Drug Information| Drug ID:   | NPD9358 |
| Drug Name:   | "Caffeine, Citrated" |
| Molecular Formula:   | C8H10N4O2.C6H8O7 |
| Canonical SMILES:   | OC(=O)C(CC(=O)O)(CC(=O)O)O.Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| Standard InCHI:   | "InChI=1S/C8H10N4O2.C6H8O7/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;7-3(8)1-6(13,5(11)12)2-4(9)10/h4H,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)" |
| Standard InCHIKey:   | RCQXSQPPHJPGOF-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9358Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6739 | NPC256849 |
| Remote Similarity | 0.6739 | NPC599846 |
| Remote Similarity | 0.5926 | NPC180493 |
| Remote Similarity | 0.5926 | NPC611613 |
| Remote Similarity | 0.5273 | NPC109322 |
| Remote Similarity | 0.5273 | NPC602664 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 194.08 |
| ALogP   | -0.4311 |
| MLogP   | 1.68 |
| XLogP   | -0.625 |
| HDA   | 6 |
| HBD   | 0 |
| Rotatable Bonds   | 3 |
| TPSA   | 58.44 |
| RO5 Violation   | 0 |