Drug Information| Drug ID:   | NPD9291 |
| Drug Name:   | Theobromine |
| Molecular Formula:   | C7H8N4O2 |
| Canonical SMILES:   | Cn1cnc2c1c(O)nc(=O)n2C |
| Standard InCHI:   | "InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13)" |
| Standard InCHIKey:   | YAPQBXQYLJRXSA-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD9291Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001596 |
| DrugBank   | DB01412 |
| ChEMBL   | CHEMBL1114 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA451646 |
| KEGG Drug   | |
| PubChem CID   | 5429 |
| ChEBI   | 28946 |
| CAS Number   | 83-67-0 |
| Molecular Weight   | 180.06 |
| ALogP   | -0.6264 |
| MLogP   | 1.57 |
| XLogP   | -0.432 |
| HDA   | 6 |
| HBD   | 1 |
| Rotatable Bonds   | 3 |
| TPSA   | 70.72 |
| RO5 Violation   | 0 |