Drug Information| Drug ID: | NPD9246 |
| Drug Name: | Chlorothiazide Sodium |
| Molecular Formula: | C7H5ClN3O4S2.Na |
| Canonical SMILES: | Clc1cc2N=C[N-]S(=O)(=O)c2cc1S(=O)(=O)N.[Na+] |
| Standard InCHI: | InChI=1S/C7H5ClN3O4S2.Na/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5;/h1-3H,(H2-,9,10,11,12,13);/q-1;+1 |
| Standard InCHIKey: | CPIWHAFLBZQYLQ-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9246Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8189 | NPC321053 |
| Remote Similarity | 0.6724 | NPC315403 |
| Remote Similarity | 0.641 | NPC43655 |
| Remote Similarity | 0.6303 | NPC107135 |
| Remote Similarity | 0.595 | NPC297532 |
| Remote Similarity | 0.5912 | NPC218710 |
| Remote Similarity | 0.5902 | NPC240134 |
| Remote Similarity | 0.5859 | NPC316435 |
| Remote Similarity | 0.5758 | NPC313810 |
| Remote Similarity | 0.5702 | NPC66775 |