Drug Information| Drug ID: | NPD9208 |
| Drug Name: | |
| Molecular Formula: | C7H12Cl3O4P |
| Canonical SMILES: | CCCOP(=O)(OC=C(Cl)Cl)OCCCl |
| Standard InCHI: | InChI=1S/C7H12Cl3O4P/c1-2-4-12-15(11,13-5-3-8)14-6-7(9)10/h6H,2-5H2,1H3 |
| Standard InCHIKey: | UVHUICINDSEUQN-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9208Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8438 | NPC290971 |
| Remote Similarity | 0.6286 | NPC120097 |
| Remote Similarity | 0.5854 | NPC314319 |
| Remote Similarity | 0.5833 | NPC68114 |
| Remote Similarity | 0.5714 | NPC315093 |
| Remote Similarity | 0.5714 | NPC314888 |