Drug Information| Drug ID: | NPD9200 |
| Drug Name: | Ethosuximide |
| Molecular Formula: | C7H11NO2 |
| Canonical SMILES: | CC1(CC)CC(=NC1=O)O |
| Standard InCHI: | InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10) |
| Standard InCHIKey: | HAPOVYFOVVWLRS-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD9200Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC21142 |
| Intermediate Similarity | 0.8 | NPC33721 |
| Remote Similarity | 0.6429 | NPC471131 |
| Remote Similarity | 0.614 | NPC19576 |
| Remote Similarity | 0.614 | NPC29950 |
| Remote Similarity | 0.5965 | NPC327239 |
| Remote Similarity | 0.5957 | NPC145895 |
| Remote Similarity | 0.5862 | NPC322946 |
| Remote Similarity | 0.5714 | NPC316826 |
| Remote Similarity | 0.5714 | NPC317143 |
| Remote Similarity | 0.5692 | NPC105297 |
| Remote Similarity | 0.5645 | NPC318260 |
| Remote Similarity | 0.5625 | NPC327170 |
| Remote Similarity | 0.5625 | NPC329564 |
| Molecular Weight | 141.08 |
| ALogP | -0.2374 |
| MLogP | 1.9 |
| XLogP | 0.751 |
| HDA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| TPSA | 49.66 |
| RO5 Violation | 0 |