Drug Information| Drug ID:   | NPD915 |
| Drug Name:   | Triclosan |
| Molecular Formula:   | C12H7Cl3O2 |
| Canonical SMILES:   | Clc1ccc(c(c1)O)Oc1ccc(cc1Cl)Cl |
| Standard InCHI:   | "InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H" |
| Standard InCHIKey:   | XEFQLINVKFYRCS-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD915Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC205213 |
| Intermediate Similarity | 0.7222 | NPC86007 |
| Remote Similarity | 0.625 | NPC44270 |
| Remote Similarity | 0.625 | NPC226737 |
| Remote Similarity | 0.625 | NPC319933 |
| Remote Similarity | 0.6098 | NPC153580 |
| Remote Similarity | 0.6053 | NPC167826 |
| Remote Similarity | 0.5952 | NPC299939 |
| Remote Similarity | 0.5952 | NPC579349 |
| Remote Similarity | 0.5909 | NPC518354 |
| Remote Similarity | 0.5897 | NPC235370 |
| Remote Similarity | 0.575 | NPC47769 |
| Remote Similarity | 0.5556 | NPC593605 |
| Remote Similarity | 0.5476 | NPC24042 |
| Remote Similarity | 0.5476 | NPC175520 |
| Remote Similarity | 0.5476 | NPC567220 |
| Remote Similarity | 0.5476 | NPC581765 |
| Remote Similarity | 0.5417 | NPC533870 |
| Remote Similarity | 0.5417 | NPC585940 |
| Remote Similarity | 0.5417 | NPC600455 |
| Remote Similarity | 0.5417 | NPC609106 |
| Remote Similarity | 0.5349 | NPC159866 |
| Remote Similarity | 0.5349 | NPC97157 |
| Molecular Weight   | 287.95 |
| ALogP   | 1.6185 |
| MLogP   | 2.23 |
| XLogP   | 4.009 |
| HDA   | 0 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 29.46 |
| RO5 Violation   | 0 |