Drug Information| Drug ID: | NPD913 |
| Drug Name: | |
| Molecular Formula: | C12H6Cl4S |
| Canonical SMILES: | Clc1ccc(cc1)Sc1cc(Cl)c(cc1Cl)Cl |
| Standard InCHI: | InChI=1S/C12H6Cl4S/c13-7-1-3-8(4-2-7)17-12-6-10(15)9(14)5-11(12)16/h1-6H |
| Standard InCHIKey: | QUWSDLYBOVGOCW-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD913Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7778 | NPC125549 |
| Intermediate Similarity | 0.7033 | NPC67863 |
| Remote Similarity | 0.6905 | NPC22627 |
| Remote Similarity | 0.6867 | NPC134584 |
| Remote Similarity | 0.6627 | NPC119076 |
| Remote Similarity | 0.6627 | NPC18259 |
| Remote Similarity | 0.6265 | NPC320749 |
| Remote Similarity | 0.5806 | NPC5324 |