Drug Information| Drug ID:   | NPD9115 |
| Drug Name:   | Dimethyl Fumarate |
| Molecular Formula:   | C6H8O4 |
| Canonical SMILES:   | COC(=O)/C=C/C(=O)OC |
| Standard InCHI:   | "InChI=1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3+" |
| Standard InCHIKey:   | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD9115Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6667 | NPC82287 |
| Remote Similarity | 0.6667 | NPC108645 |
| Remote Similarity | 0.6667 | NPC491295 |
| Remote Similarity | 0.6667 | NPC544775 |
| Remote Similarity | 0.6111 | NPC576386 |
| Remote Similarity | 0.55 | NPC37872 |
| Remote Similarity | 0.55 | NPC495447 |
| Remote Similarity | 0.5294 | NPC538454 |
| Remote Similarity | 0.5238 | NPC212911 |
| Remote Similarity | 0.5238 | NPC113685 |
| Remote Similarity | 0.5238 | NPC297608 |
| Remote Similarity | 0.5238 | NPC145746 |
| Remote Similarity | 0.5238 | NPC206196 |
| Remote Similarity | 0.5238 | NPC277246 |
| Remote Similarity | 0.5238 | NPC245012 |
| Remote Similarity | 0.5238 | NPC571999 |
| TTD   | DNCL003405; DNCL003406 |
| DrugBank   | DB08908 |
| ChEMBL   | CHEMBL2107333 |
| IUPHAR/BPS   | 7045 |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 637568 |
| ChEBI   | 76004 |
| CAS Number   | 624-49-7 |
| Molecular Weight   | 144.04 |
| ALogP   | 0.2768 |
| MLogP   | 1.68 |
| XLogP   | 0.226 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 6 |
| TPSA   | 52.6 |
| RO5 Violation   | 0 |