NPASS drugs

Drug Information

Drug ID:	NPD911
Drug Name:	Bithionol
Molecular Formula:	C12H6Cl4O2S
Canonical SMILES:	Clc1cc(Sc2cc(Cl)cc(c2O)Cl)c(c(c1)Cl)O
Standard InCHI:	"InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H"
Standard InCHIKey:	JFIOVJDNOJYLKP-UHFFFAOYSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD911

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	179131
0.1-0.2	32014
0.2-0.3	519
0.3-0.4	52
0.4-0.5	8
0.5-0.6	4
0.6-0.7	6
0.7-0.8	6
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7576	NPC583006
Intermediate Similarity	0.7576	NPC601831
Intermediate Similarity	0.7353	NPC104124
Intermediate Similarity	0.7059	NPC196371
Intermediate Similarity	0.7059	NPC586863
Intermediate Similarity	0.7059	NPC603923
Remote Similarity	0.6857	NPC44270
Remote Similarity	0.6667	NPC137922
Remote Similarity	0.6667	NPC40302
Remote Similarity	0.6316	NPC170824
Remote Similarity	0.6316	NPC63317
Remote Similarity	0.6154	NPC68350
Remote Similarity	0.5854	NPC230013
Remote Similarity	0.5854	NPC483502
Remote Similarity	0.5854	NPC88733
Remote Similarity	0.5854	NPC81149

Drug Structure

NPD911 OpenBabel08201723412D 21 22 0 0 0 0 0 0 0 0999 V2000 -3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 2 0 0 0 0 1 7 1 0 0 0 0 2 6 2 0 0 0 0 2 8 1 0 0 0 0 3 5 1 0 0 0 0 3 9 2 0 0 0 0 4 6 1 0 0 0 0 4 10 2 0 0 0 0 5 13 1 0 0 0 0 6 14 1 0 0 0 0 7 11 2 0 0 0 0 7 15 1 0 0 0 0 8 12 2 0 0 0 0 8 16 1 0 0 0 0 9 11 1 0 0 0 0 9 19 1 0 0 0 0 10 12 1 0 0 0 0 10 19 1 0 0 0 0 11 17 1 0 0 0 0 12 18 1 0 0 0 0 17 20 1 0 0 0 0 18 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC011355
DrugBank	DB04813
ChEMBL	CHEMBL290106
IUPHAR/BPS
PharmaGKB
KEGG Drug	D00802
PubChem CID	2406
ChEBI	3131
CAS Number	97-18-7

Drug Properties

Molecular Weight	353.88
ALogP	2.6472
MLogP	2.01
XLogP	3.473
HDA	0
HBD	2
Rotatable Bonds	8
TPSA	65.76
RO5 Violation	0