Drug Information| Drug ID:   | NPD9065 |
| Drug Name:   | Phytic Acid; Myo-inositol Hexaphosphate |
| Molecular Formula:   | C6H18O24P6 |
| Canonical SMILES:   | OP(=O)(O[C@@H]1[C@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]([C@@H]([C@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)O |
| Standard InCHI:   | "InChI=1S/C6H18O24P6/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t1-,2-,3-,4+,5-,6-" |
| Standard InCHIKey:   | IMQLKJBTEOYOSI-GPIVLXJGSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9065Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC188428 |
| High Similarity | 1.0 | NPC153283 |
| High Similarity | 1.0 | NPC53401 |
| Remote Similarity | 0.619 | NPC318084 |
| Remote Similarity | 0.619 | NPC318700 |
| Remote Similarity | 0.5909 | NPC32561 |
| Remote Similarity | 0.5714 | NPC317825 |
| Remote Similarity | 0.5714 | NPC609544 |
| Remote Similarity | 0.5455 | NPC278465 |
| Remote Similarity | 0.5455 | NPC325153 |
| Remote Similarity | 0.5455 | NPC322803 |
| Remote Similarity | 0.5263 | NPC31433 |
| Molecular Weight   | 659.86 |
| ALogP   | -2.679 |
| MLogP   | -1.18 |
| XLogP   | -11.406 |
| HDA   | 24 |
| HBD   | 12 |
| Rotatable Bonds   | 24 |
| TPSA   | 459.42 |
| RO5 Violation   | 3 |