Drug Information| Drug ID:   | NPD9030 |
| Drug Name:   | Glucosamine Hydrochloride |
| Molecular Formula:   | C6H13NO5.ClH |
| Canonical SMILES:   | OC[C@H]1O[C@H](O)[C@@H]([C@H]([C@@H]1O)O)N.Cl |
| Standard InCHI:   | "InChI=1S/C6H13NO5.ClH/c7-3-5(10)4(9)2(1-8)12-6(3)11;/h2-6,8-11H,1,7H2;1H/t2-,3-,4-,5-,6+;/m1./s1" |
| Standard InCHIKey:   | QKPLRMLTKYXDST-WQIPCXMXSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9030Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC600025 |
| High Similarity | 0.9615 | NPC293981 |
| High Similarity | 0.9615 | NPC324750 |
| High Similarity | 0.9615 | NPC125353 |
| High Similarity | 0.9615 | NPC310601 |
| High Similarity | 0.9615 | NPC291650 |
| High Similarity | 0.9615 | NPC501164 |
| High Similarity | 0.9615 | NPC606475 |
| High Similarity | 0.9615 | NPC593955 |
| High Similarity | 0.9615 | NPC600826 |
| High Similarity | 0.9615 | NPC611225 |
| Remote Similarity | 0.6129 | NPC247836 |
| Remote Similarity | 0.6129 | NPC304357 |
| Remote Similarity | 0.5938 | NPC584825 |
| Remote Similarity | 0.5556 | NPC554783 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 179.08 |
| ALogP   | -2.803 |
| MLogP   | 1.46 |
| XLogP   | -1.764 |
| HDA   | 6 |
| HBD   | 5 |
| Rotatable Bonds   | 6 |
| TPSA   | 116.17 |
| RO5 Violation   | 0 |