Drug Information| Drug ID:   | NPD9008 |
| Drug Name:   | Calcium Lactate Gluconate |
| Molecular Formula:   | C6H12O7.C3H6O3.Ca |
| Canonical SMILES:   | [O-]C(=O)C(O)C.OC[C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.[Ca+2] |
| Standard InCHI:   | "InChI=1S/C6H12O7.C3H6O3.Ca/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2(4)3(5)6;/h2-5,7-11H,1H2,(H,12,13);2,4H,1H3,(H,5,6);/q;;+2/p-2/t2-,3-,4+,5-;;/m1../s1" |
| Standard InCHIKey:   | PWKNEBQRTUXXLT-ZBHRUSISSA-L |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9008Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.913 | NPC319863 |
| High Similarity | 0.913 | NPC73584 |
| High Similarity | 0.913 | NPC304431 |
| Remote Similarity | 0.68 | NPC322167 |
| Remote Similarity | 0.5833 | NPC231722 |
| Remote Similarity | 0.5833 | NPC22339 |
| Remote Similarity | 0.56 | NPC322601 |
| Remote Similarity | 0.5517 | NPC326369 |
| Remote Similarity | 0.5172 | NPC304434 |
| Remote Similarity | 0.5172 | NPC317790 |
| Remote Similarity | 0.5172 | NPC277878 |
| Remote Similarity | 0.5172 | NPC246117 |
| Remote Similarity | 0.5172 | NPC601874 |
| Remote Similarity | 0.5172 | NPC607575 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 195.05 |
| ALogP   | -3.5158 |
| MLogP   | 1.35 |
| XLogP   | -4.22 |
| HDA   | 7 |
| HBD   | 5 |
| Rotatable Bonds   | 11 |
| TPSA   | 141.28 |
| RO5 Violation   | 0 |