Drug Information| Drug ID:   | NPD9004 |
| Drug Name:   | |
| Molecular Formula:   | C6H12O6 |
| Canonical SMILES:   | OC[C@H]([C@H]([C@@H](C(=O)CO)O)O)O |
| Standard InCHI:   | "InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1" |
| Standard InCHIKey:   | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD9004Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC247546 |
| High Similarity | 1.0 | NPC113101 |
| High Similarity | 1.0 | NPC558905 |
| High Similarity | 0.85 | NPC53028 |
| High Similarity | 0.85 | NPC24219 |
| High Similarity | 0.85 | NPC206012 |
| Intermediate Similarity | 0.8095 | NPC250348 |
| Intermediate Similarity | 0.75 | NPC490425 |
| Intermediate Similarity | 0.7368 | NPC228782 |
| Intermediate Similarity | 0.7368 | NPC259982 |
| Intermediate Similarity | 0.7368 | NPC121713 |
| Intermediate Similarity | 0.7368 | NPC323347 |
| Remote Similarity | 0.6667 | NPC319646 |
| Remote Similarity | 0.6316 | NPC515233 |
| Remote Similarity | 0.6087 | NPC249980 |
| Remote Similarity | 0.55 | NPC163148 |
| Remote Similarity | 0.5238 | NPC314365 |
| Molecular Weight   | 180.06 |
| ALogP   | -3.0134 |
| MLogP   | 1.46 |
| XLogP   | -3.839 |
| HDA   | 6 |
| HBD   | 5 |
| Rotatable Bonds   | 10 |
| TPSA   | 118.22 |
| RO5 Violation   | 0 |