Drug Information| Drug ID:   | NPD8996 |
| Drug Name:   | Inositol |
| Molecular Formula:   | C6H12O6 |
| Canonical SMILES:   | O[C@@H]1[C@H](O)[C@H](O)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI:   | "InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5-,6-" |
| Standard InCHIKey:   | CDAISMWEOUEBRE-GPIVLXJGSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8996Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC227707 |
| High Similarity | 1.0 | NPC99573 |
| High Similarity | 1.0 | NPC102981 |
| High Similarity | 1.0 | NPC88278 |
| High Similarity | 1.0 | NPC137987 |
| High Similarity | 1.0 | NPC113212 |
| High Similarity | 1.0 | NPC134616 |
| High Similarity | 1.0 | NPC530323 |
| High Similarity | 1.0 | NPC608400 |
| High Similarity | 1.0 | NPC608437 |
| Remote Similarity | 0.5714 | NPC163707 |
| Remote Similarity | 0.5714 | NPC264395 |
| Remote Similarity | 0.5455 | NPC248933 |
| Remote Similarity | 0.5455 | NPC31981 |
| Remote Similarity | 0.5455 | NPC557214 |
| Remote Similarity | 0.5455 | NPC584813 |
| Remote Similarity | 0.5455 | NPC610241 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 180.06 |
| ALogP   | -3.0642 |
| MLogP   | 1.46 |
| XLogP   | -1.458 |
| HDA   | 6 |
| HBD   | 6 |
| Rotatable Bonds   | 6 |
| TPSA   | 121.38 |
| RO5 Violation   | 1 |