Drug Information| Drug ID:   | NPD8979 |
| Drug Name:   | Eflornithine Hydrochloride Hydrate |
| Molecular Formula:   | C6H12F2N2O2.ClH.H2O |
| Canonical SMILES:   | NCCCC(C(=O)O)(C(F)F)N.O.Cl |
| Standard InCHI:   | "InChI=1S/C6H12F2N2O2.ClH.H2O/c7-4(8)6(10,5(11)12)2-1-3-9;;/h4H,1-3,9-10H2,(H,11,12);1H;1H2" |
| Standard InCHIKey:   | FJPAMFNRCFEGSD-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8979Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 182.09 |
| ALogP   | -1.4415 |
| MLogP   | 1.46 |
| XLogP   | -2.711 |
| HDA   | 4 |
| HBD   | 3 |
| Rotatable Bonds   | 10 |
| TPSA   | 89.34 |
| RO5 Violation   | 0 |