Drug Information| Drug ID:   | NPD8947 |
| Drug Name:   | Fluciclovine F18 |
| Molecular Formula:   | C6H10FNO2 |
| Canonical SMILES:   | OC(=O)[C@]1(N)C[C@](C1)(C)[18F] |
| Standard InCHI:   | "InChI=1S/C6H10FNO2/c1-5(7)2-6(8,3-5)4(9)10/h2-3,8H2,1H3,(H,9,10)/t5-,6-/i7-1" |
| Standard InCHIKey:   | ILMJJAKSEOUEPX-DZQYMRDVSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8947Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 147.07 |
| ALogP   | -0.5155 |
| MLogP   | 1.68 |
| XLogP   | -2.157 |
| HDA   | 3 |
| HBD   | 2 |
| Rotatable Bonds   | 5 |
| TPSA   | 63.32 |
| RO5 Violation   | 0 |