Drug Information| Drug ID: | NPD8871 |
| Drug Name: | Glutamic Acid Hydrochloride |
| Molecular Formula: | C5H9NO4.ClH |
| Canonical SMILES: | OC(=O)CC[C@@H](C(=O)O)N.Cl |
| Standard InCHI: | InChI=1S/C5H9NO4.ClH/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H/t3-;/m0./s1 |
| Standard InCHIKey: | RPAJSBKBKSSMLJ-DFWYDOINSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8871Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7